CAS 14748-94-8
:1,2,4-Naphthalenetriol, 3-methyl-, 2-(4-aminobenzoate)
Description:
1,2,4-Naphthalenetriol, 3-methyl-, 2-(4-aminobenzoate) is a chemical compound characterized by its complex structure, which includes a naphthalene core with multiple hydroxyl groups and an amino benzoate moiety. This compound features three hydroxyl (-OH) groups located at the 1, 2, and 4 positions of the naphthalene ring, contributing to its potential reactivity and solubility in polar solvents. The presence of a methyl group at the 3 position and a 4-aminobenzoate substituent enhances its functional properties, possibly influencing its biological activity and interaction with other molecules. The compound may exhibit antioxidant properties due to the presence of hydroxyl groups, which can donate hydrogen atoms to free radicals. Additionally, the amino benzoate group may impart specific pharmacological activities, making it of interest in medicinal chemistry. Overall, the unique combination of functional groups in this compound suggests potential applications in pharmaceuticals, materials science, and organic synthesis.
Formula:C18H15NO4
InChI:InChI=1S/C18H15NO4/c1-10-15(20)13-4-2-3-5-14(13)16(21)17(10)23-18(22)11-6-8-12(19)9-7-11/h2-9,20-21H,19H2,1H3
InChI key:InChIKey=YLMPBJUYFTWHKJ-UHFFFAOYSA-N
SMILES:OC=1C2=C(C(O)=C(C)C1OC(=O)C3=CC=C(N)C=C3)C=CC=C2
Synonyms:- 1,2,4-Naphthalenetriol, 3-methyl-, 2-(4-aminobenzoate)
- 1,2,4-Naphthalenetriol, 3-methyl-, 2-(p-aminobenzoate)
- 1,4-Dihydroxy-3-Methylnaphthalen-2-Yl 4-Aminobenzoate
- 3-Methyl-1,2,4-naphthalenetriol-2-(4-aminobenzoate)
- Aminaftone
- Aminaphthone
- Capilarema
- 1,4-Dihydroxy-3-methyl-2-naphthyl 4-aminobenzoate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,4-Naphthalenetriol, 3-methyl-, 2-(4-aminobenzoate)
CAS:Formula:C18H15NO4Purity:95%Molecular weight:309.31601,4-Dihydroxy-3-methyl-2-naphthyl 4-aminobenzoate
CAS:1,4-Dihydroxy-3-methyl-2-naphthyl 4-aminobenzoate is an antihistamine that blocks the histamine H1 receptor. It is used to treat itching and other symptoms in skin conditions such as periungual dermatitis and eczema. The drug is also used to diagnose allergic diseases, such as asthma. 1,4-Dihydroxy-3-methyl-2-naphthyl 4-aminobenzoate binds to the H1 receptor on cells and prevents the release of inflammatory mediators from mast cells and basophils. This effect is mediated by a decrease in calcium influx through the cell membrane, which inhibits the production of tumor necrosis factor alpha (TNFα) and interleukin (IL) -4. In addition, 1,4-dihydroxy 3 methyl 2 naphthyl 4 aminobenzoate has been shown to beFormula:C18H15NO4Purity:Min. 95%Molecular weight:309.32 g/molAminaftone
CAS:Aminaftone, a derivative of 4-aminobenzoic acid, inhibits endothelin-1 (ET-1) production and can be used to study hypertension and systemic sclerosis.Formula:C18H15NO4Purity:96.31% - 99.39%Color and Shape:SolidMolecular weight:309.32





