CAS 147497-64-1
:Davasaicin
Description:
Davasaicin, with the CAS number 147497-64-1, is a chemical compound that belongs to the class of natural products known as alkaloids. It is primarily derived from certain plant species and is noted for its potential pharmacological properties. The substance exhibits a complex molecular structure, which contributes to its biological activity. Davasaicin has been studied for its anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry and pharmacology. Its mechanism of action may involve modulation of specific receptors or pathways in the body, although detailed studies are necessary to fully elucidate these interactions. Additionally, like many alkaloids, Davasaicin may exhibit varying solubility in different solvents, influencing its bioavailability and therapeutic applications. Safety and toxicity profiles are essential considerations in its use, particularly in clinical settings. Overall, Davasaicin represents a promising area of research within the field of natural product chemistry, with potential implications for drug development and therapeutic use.
Formula:C22H30N2O3
InChI:InChI=1/C22H30N2O3/c1-16-6-7-18(13-17(16)2)5-4-11-24-22(25)15-19-8-9-20(27-12-10-23)21(14-19)26-3/h6-9,13-14H,4-5,10-12,15,23H2,1-3H3,(H,24,25)
SMILES:Cc1ccc(CCCN=C(Cc2ccc(c(c2)OC)OCCN)O)cc1C
Synonyms:- Kr 25018
- Unii-8V3419G4Nr
- 2-[4-(2-aminoethoxy)-3-methoxyphenyl]-N-[3-(3,4-dimethylphenyl)propyl]acetamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Davasaicin
CAS:Davasaicin is a synthetic capsanoid.Formula:C22H30N2O3Color and Shape:SolidMolecular weight:370.49

