CAS 147523-65-7
:(4S,5R)-N-(4-bromophenyl)-3-oxo-4,5-diphenylpyrazolidine-1-carboxamide
Description:
The chemical substance known as (4S,5R)-N-(4-bromophenyl)-3-oxo-4,5-diphenylpyrazolidine-1-carboxamide, with the CAS number 147523-65-7, is a pyrazolidine derivative characterized by its complex structure featuring a pyrazolidine ring, which is a five-membered heterocyclic compound containing two nitrogen atoms. This compound exhibits chirality, indicated by the (4S,5R) configuration, which suggests specific spatial arrangements of its substituents that can influence its biological activity and interactions. The presence of a bromophenyl group and diphenyl substituents contributes to its lipophilicity and potential for various chemical interactions. The keto and amide functional groups present in the molecule are significant for its reactivity and solubility properties. Such compounds are often studied for their pharmacological potential, including anti-inflammatory and analgesic activities. Overall, the unique structural features of this substance make it a subject of interest in medicinal chemistry and drug development.
Formula:C22H18BrN3O2
InChI:InChI=1/C22H18BrN3O2/c23-17-11-13-18(14-12-17)24-22(28)26-20(16-9-5-2-6-10-16)19(21(27)25-26)15-7-3-1-4-8-15/h1-14,19-20H,(H,24,28)(H,25,27)/t19-,20-/m0/s1
SMILES:c1ccc(cc1)[C@H]1[C@H](c2ccccc2)N(C(=O)Nc2ccc(cc2)Br)N=C1O
Synonyms:- 1-Pyrazolidinecarboxamide, N-(4-bromophenyl)-3-oxo-4,5-diphenyl-, (4S,5R)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
LY 288513
CAS:LY 288513 is a synthetic small molecule compound, which is developed through rigorous chemical synthesis. It primarily originates from the advanced field of medicinal chemistry, where it has been designed and optimized for its biochemical activity and specificity. The mode of action for LY 288513 involves the modulation of certain metabolic pathways within cells, acting as a receptor antagonist to influence intracellular signaling cascades. This interaction results in altered cellular responses, potentially leading to therapeutic outcomes.
Formula:C22H18BrN3O2Purity:Min. 95%Molecular weight:436.3 g/molLY288513
CAS:Selective CCK2 receptor antagonistFormula:C22H18BrN3O2Purity:98%Color and Shape:SolidMolecular weight:436.3

