CAS 147540-88-3

N-Fluoro-4-methylpyridinium-2-sulphonate

Description:

N-Fluoro-4-methylpyridinium-2-sulphonate is a chemical compound characterized by its unique structure, which includes a pyridinium ring substituted with a fluorine atom and a sulfonate group. This compound is typically used as a reagent in organic synthesis, particularly in fluorination reactions, where the presence of the fluorine atom facilitates the introduction of fluorine into various organic substrates. It is known for its stability under standard conditions, making it a valuable tool in synthetic chemistry. The sulfonate group enhances its solubility in polar solvents, which is advantageous for various applications. Additionally, the compound exhibits moderate toxicity, necessitating appropriate safety precautions during handling. Its reactivity profile allows it to participate in nucleophilic substitution reactions, contributing to its utility in the synthesis of fluorinated compounds. Overall, N-Fluoro-4-methylpyridinium-2-sulphonate is a versatile reagent with significant applications in the field of medicinal chemistry and materials science.

Formula: C₆H₆FNO₃S

InChI: InChI=1/C6H6FNO3S/c1-5-2-3-8(7)6(4-5)12(9,10)11/h2-4H,1H3

SMILES: Cc1cc[n+](c(c1)[S-](=O)(=O)=O)F

Synonyms:

• 1-Fluoro-4-Methylpyridinium-2-Sulfonate

Pyridinium, 1-fluoro-4-methyl-2-sulfo-, inner salt

CAS: 147540-88-3

Formula: C₆H₆FNO₃S

Color and Shape: Solid

Molecular weight: 191.1801

Ref: IN-DA001EZ5

N-Fluoro-4-methylpyridinium-2-sulphonate

CAS: 147540-88-3

N-Fluoro-4-methylpyridinium-2-sulphonate

Purity: ≥95%

Color and Shape: Solid

Molecular weight: 191.18g/mol

Ref: 54-PC4003

N-Fluoro-4-methylpyridinium-2-sulfonate

CAS: 147540-88-3

Formula: C₆H₆FNO₃S

Color and Shape: White to pale yellow powder

Molecular weight: 191.18

Ref: 10-F019185