CAS 14757-78-9
:3-BROMO-2-FORMYLFURAN
Description:
3-Bromo-2-formylfuran is an organic compound characterized by its furan ring structure, which is a five-membered aromatic ring containing one oxygen atom. The presence of a bromine atom at the 3-position and a formyl group (-CHO) at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound is typically a pale yellow to brown liquid or solid, depending on its purity and form. It is known for its role in various chemical reactions, including nucleophilic substitutions and as an intermediate in the synthesis of more complex molecules. The bromine substituent enhances the electrophilicity of the furan ring, making it a useful building block in the development of pharmaceuticals and agrochemicals. Additionally, 3-bromo-2-formylfuran may exhibit biological activity, which warrants further investigation for potential applications in medicinal chemistry. As with many brominated compounds, it is important to handle it with care due to potential toxicity and environmental concerns.
Formula:C5H3BrO2
InChI:InChI=1/C5H3BrO2/c6-4-1-2-8-5(4)3-7/h1-3H
SMILES:c1coc(C=O)c1Br
Synonyms:- 3-Bromo-Furan-2-Carbaldehyde
- 3-Bromo-2-furaldehyde
- 3-Bromofuran-2-carboxaldehyde
- 3-Bromo-2-formylfuran, 3-Bromo-2-furaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
3-Bromo-2-furaldehyde
CAS:Formula:C5H3BrO2Purity:>98.0%(GC)Color and Shape:White or Colorless to Light orange to Yellow powder to lump to clear liquidMolecular weight:174.983-Bromofuran-2-carbaldehyde
CAS:Formula:C5H3BrO2Purity:98%Color and Shape:SolidMolecular weight:174.98013-Bromo-2-furaldehyde
CAS:3-Bromo-2-furaldehydeFormula:C5H3BrO2Purity:97%Color and Shape: dark brown crystalsMolecular weight:174.98g/mol3-Bromofuran-2-carbaldehyde
CAS:Formula:C5H3BrO2Purity:98%Color and Shape:LiquidMolecular weight:174.9813-Bromofuran-2-carbaldehyde
CAS:3-Bromofuran-2-carbaldehyde is a chemical compound that belongs to the group of carbonyl compounds. It is an acetylated form of 3-bromofuran and its molecular formula is C6H5BrO. This chemical contains a carbonyl group, which reacts with the hydroxyl group in epidermal growth factor (EGF) to produce epidermal growth. 3-Bromofuran-2-carbaldehyde has been shown to be an adrenergic receptor agonist and can be used as a structural formula blocker or hydrochloric acid. The chemical can also be synthesized in acidic conditions using methods such as fluorination, chlorination, and acetylation.Formula:C5H3BrO2Purity:Min. 95%Molecular weight:174.98 g/mol





