CAS 14759-04-7
:Oxyridazine
Description:
Oxyridazine, with the CAS number 14759-04-7, is a chemical compound that belongs to the class of heterocyclic compounds, specifically a derivative of the diazine family. It is characterized by its unique molecular structure, which typically includes a combination of nitrogen and carbon atoms arranged in a cyclic formation. This compound is known for its potential applications in various fields, including pharmaceuticals and agrochemicals. Oxyridazine may exhibit specific biological activities, making it of interest in medicinal chemistry for the development of therapeutic agents. Its physical properties, such as solubility, melting point, and stability, can vary based on its formulation and the presence of functional groups. Safety and handling considerations are essential, as with many chemical substances, due to potential toxicity or reactivity. Overall, oxyridazine represents a compound with diverse implications in chemical research and application, warranting further investigation to fully understand its properties and potential uses.
Formula:C21H26N2OS
InChI:InChI=1/C21H26N2OS/c1-22-13-6-5-7-16(22)12-14-23-18-8-3-4-9-20(18)25-21-11-10-17(24-2)15-19(21)23/h3-4,8-11,15-16H,5-7,12-14H2,1-2H3
Synonyms:- 2-Methoxy-10-(2-(1-methyl-2-piperidyl)ethyl)phenothiazine
- 10H-Phenothiazine, 2-methoxy-10-(2-(1-methyl-2-piperidinyl)ethyl)- (9CI)
- 3-Methoxy-10-(2'-(N-methylpiperidyl-2')-ethyl)phenothiazine
- Oxyridazinum
- NSC 186057
- KS-33
- 4-27-00-02038 (Beilstein Handbook Reference)
- Oxyridazinum [INN-Latin]
- UNII-OCW5XQQ13I
- Oxiridazina
- BRN 6118065
- 2-methoxy-10-[2-(1-methylpiperidin-2-yl)ethyl]-10H-phenothiazine
- Oxyridazine [INN]
- Oxiridazina [INN-Spanish]
- KS 33
- 10H-Phenothiazine, 2-methoxy-10-(2-(1-methyl-2-piperidyl)ethyl)-
- Phenothiazine, 2-methoxy-10-(2-(1-methyl-2-piperidyl)ethyl)-
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Oxyridazine
CAS:<p>Oxyridazine is a bioactive chemical.</p>Formula:C21H26N2OSColor and Shape:SolidMolecular weight:354.51
