CAS 14759-07-0
:1-(2-PIPERIDIN-2-YL-ETHYL)-PIPERIDINE
Description:
1-(2-Piperidin-2-yl-ethyl)-piperidine, with the CAS number 14759-07-0, is a chemical compound that belongs to the class of piperidine derivatives. It features a piperidine ring structure, which is a six-membered saturated heterocyclic compound containing one nitrogen atom. This substance is characterized by its two piperidine moieties connected by an ethyl chain, which contributes to its unique properties. The presence of the piperidine rings suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as piperidine derivatives are often associated with various biological activities. The compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its solubility in organic solvents and moderate polarity may influence its behavior in biological systems and its interactions with other chemical entities. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C12H24N2
InChI:InChI=1/C12H24N2/c1-4-9-14(10-5-1)11-7-12-6-2-3-8-13-12/h12-13H,1-11H2
SMILES:C1CCN(CC1)CCC1CCCCN1
Synonyms:- Asinex-Reag Bas 13149384
- 1-Piperidino-2-[2]Piperidyl-Ethane
- 2-(2-N-Piperidinoethyl)Piperidine
- Akos Bbs-00005288
- Timtec-Bb Sbb010955
- Zerenex Zx006985
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
