CAS 1476-34-2
:6-Ketoestrone
Description:
6-Ketoestrone, with the CAS number 1476-34-2, is a steroid hormone and a derivative of estrone, which is a form of estrogen. It is characterized by the presence of a keto group at the 6-position of the steroid nucleus, which distinguishes it from other estrogens. This compound is typically found in biological systems and can be involved in various metabolic pathways related to steroidogenesis. 6-Ketoestrone is known for its potential role in the regulation of reproductive functions and may exhibit biological activities similar to those of other estrogens, although its potency and specific effects can vary. In terms of physical properties, it is generally a solid at room temperature and may be soluble in organic solvents. Its chemical structure includes multiple rings typical of steroid compounds, contributing to its biological activity. As with many steroid hormones, it is important to handle 6-Ketoestrone with care in laboratory settings due to its potential effects on biological systems.
Formula:C18H20O3
InChI:InChI=1S/C18H20O3/c1-18-7-6-12-11-3-2-10(19)8-14(11)16(20)9-13(12)15(18)4-5-17(18)21/h2-3,8,12-13,15,19H,4-7,9H2,1H3/t12-,13-,15+,18+/m1/s1
InChI key:InChIKey=JOVYPIGRPWIXHQ-ONUSSAAZSA-N
SMILES:C[C@@]12[C@]([C@]3([C@@](C=4C(C(=O)C3)=CC(O)=CC4)(CC1)[H])[H])(CCC2=O)[H]
Synonyms:- 3-Hydroxyestra-1,3,5(10)-Triene-6,17-Dione
- 6-Oxoestrone
- Estra-1,3,5(10)-triene-6,17-dione, 3-hydroxy-
- 6-Ketoestrone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
