CAS 14760-71-5

α-Hydrazinyl-1H-imidazole-5-propanoic acid

Description:

α-Hydrazinyl-1H-imidazole-5-propanoic acid, with the CAS number 14760-71-5, is a chemical compound that features a hydrazine functional group attached to an imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. This compound is characterized by its potential biological activity, particularly in the context of medicinal chemistry, where it may exhibit properties relevant to the development of pharmaceuticals. The presence of the propanoic acid moiety suggests that it may participate in various chemical reactions, including esterification and amidation. Its structure allows for hydrogen bonding and potential interactions with biological targets, making it of interest in drug design. Additionally, the compound's solubility and stability can be influenced by the pH of the environment, which is a critical factor in its application in biological systems. Overall, α-Hydrazinyl-1H-imidazole-5-propanoic acid represents a unique scaffold for further exploration in chemical and pharmaceutical research.

Formula: C₆H₁₀N₄O₂

InChI: InChI=1S/C6H10N4O2/c7-10-5(6(11)12)1-4-2-8-3-9-4/h2-3,5,10H,1,7H2,(H,8,9)(H,11,12)

InChI key: InChIKey=OTXNLKCKMZUQKX-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)NN)C1=CN=CN1

Synonyms:

• 1H-Imidazole-4-propanoic acid, α-hydrazino-, (±)-
• 1H-Imidazole-4-propanoic acid, α-hydrazino-
• 1H-Imidazole-5-propanoic acid, α-hydrazinyl-
• α-Hydrazinyl-1H-imidazole-5-propanoic acid
• Imidazole-4-propionic acid, α-hydrazino-, DL-

MK785

CAS: 14760-71-5

MK785 inhibits aortic histidine decarboxylase, reducing histamine formation and albumin permeability, impacting atherosclerosis.

Formula: C₆H₁₀N₄O₂

Color and Shape: Solid

Molecular weight: 170.17

Ref: TM-T33440