CAS 14761-39-8

2-chloro-1-(4-phenylpiperazino)ethan-1-one

Description:

2-Chloro-1-(4-phenylpiperazino)ethan-1-one, with the CAS number 14761-39-8, is a chemical compound characterized by its structural features, which include a chloro group and a piperazine moiety. This compound typically exhibits properties associated with both its aromatic and aliphatic components, contributing to its potential biological activity. The presence of the piperazine ring suggests possible interactions with neurotransmitter systems, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting central nervous system disorders. The chloro substituent may influence the compound's reactivity and solubility, affecting its pharmacokinetic properties. Additionally, the compound's molecular structure indicates it may participate in hydrogen bonding and other intermolecular interactions, which are crucial for its biological efficacy. Overall, 2-chloro-1-(4-phenylpiperazino)ethan-1-one represents a class of compounds that may have significant implications in drug design and development, warranting further investigation into its chemical behavior and potential therapeutic applications.

Formula: C₁₂H₁₅ClN₂O

InChI: InChI=1/C12H15ClN2O/c13-10-12(16)15-8-6-14(7-9-15)11-4-2-1-3-5-11/h1-5H,6-10H2

SMILES: c1ccc(cc1)N1CCN(CC1)C(=O)CCl

Synonyms:

• 2-Chloro-1-(4-Phenylpiperazin-1-Yl)Ethanone

1-(Chloroacetyl)-4-phenylpiperazine

CAS: 14761-39-8

Formula: C₁₂H₁₅ClN₂O

Color and Shape: Solid

Molecular weight: 238.7133

Ref: IN-DA001F1J

2-chloro-1-(4-phenylpiperazino)ethan-1-one

CAS: 14761-39-8

2-chloro-1-(4-phenylpiperazino)ethan-1-one

Purity: ≥95%

Molecular weight: 238.71g/mol

Ref: 54-OR25687

2-Chloro-1-(4-phenylpiperazin-1-yl)ethanone

CAS: 14761-39-8

Formula: C₁₂H₁₅ClN₂O

Purity: 95.0%

Molecular weight: 238.72

Ref: 10-F449188

1-(Chloroacetyl)-4-phenylpiperazine

Controlled Product

CAS: 14761-39-8

1-(Chloroacetyl)-4-phenylpiperazine (PCAP) is a piperazine-derived antiparasitic drug that inhibits the growth of malaria parasites. PCAP binds to the active site of plasmodium falciparum and prevents the conversion of host hemoglobin into hemozoin, which is toxic to the parasite. It also has been shown to act as a metabolic stability marker for use in screening for drug resistant strains of plasmodium falciparum.

Formula: C₁₂H₁₅ClN₂O

Purity: Min. 95%

Molecular weight: 238.71 g/mol

Ref: 3D-FC127629