CAS 147644-11-9
:7-BROMO-3,4-DIHYDRO-2H-1,5-BENZODIOXEPINE
Description:
7-Bromo-3,4-dihydro-2H-1,5-benzodioxepine is a chemical compound characterized by its unique bicyclic structure, which includes a benzodioxepine core. This compound features a bromine substituent at the 7-position, contributing to its reactivity and potential biological activity. The presence of the dioxepine ring system indicates that it contains both ether and cyclic structures, which can influence its solubility and stability. Typically, compounds of this class may exhibit interesting pharmacological properties, making them of interest in medicinal chemistry. The molecular structure suggests potential interactions with biological targets, although specific biological activities would depend on further empirical studies. Additionally, the compound's CAS number, 147644-11-9, allows for precise identification in chemical databases, facilitating research and application in various fields, including drug development and synthetic chemistry. As with many brominated compounds, it may also exhibit unique properties related to its halogen content, such as increased lipophilicity or altered electronic characteristics.
Formula:C9H9BrO2
InChI:InChI=1/C9H9BrO2/c10-7-2-3-8-9(6-7)12-5-1-4-11-8/h2-3,6H,1,4-5H2
SMILES:C1COc2ccc(cc2OC1)Br
Synonyms:- Akos Bbs-00006807
- 4-Bromo-1,2-trimethylenedioxybenzene
- 7-Bromo-3,4-dihydro-1,5-benzodioxepin, 96%
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
7-Bromo-3,4-dihydro-1,5-benzodioxepin, 96%
CAS:<p>This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci</p>Formula:C9H9BrO2Purity:96%Color and Shape:Clear colorless to yellow, LiquidMolecular weight:229.077-Bromo-3,4-dihydro-2H-benzo[b][1,4]dioxepine
CAS:Formula:C9H9BrO2Purity:96%Molecular weight:229.07067-Bromo-3,4-dihydro-2H-1,5-benzodioxepine
CAS:7-Bromo-3,4-dihydro-2H-1,5-benzodioxepinePurity:≥95%Molecular weight:229.07g/mol7-Bromo-3,4-dihydro-2H-1,5-benzodioxepine
CAS:<p>Versatile small molecule scaffold</p>Formula:C9H9BrO2Purity:Min. 95%Molecular weight:229.07 g/mol




