CymitQuimica logo

CAS 147657-35-0

:

CINERUBIN

Description:
Cinerubin, with the CAS number 147657-35-0, is a chemical compound that belongs to the class of natural pigments known as anthraquinones. It is primarily derived from certain species of fungi and has been studied for its potential applications in various fields, including pharmaceuticals and cosmetics. Cinerubin exhibits a vibrant red color, which is attributed to its unique molecular structure that allows it to absorb specific wavelengths of light. This compound is known for its antioxidant properties, which may contribute to its efficacy in protecting cells from oxidative stress. Additionally, cinerubin has been investigated for its potential antimicrobial and anti-inflammatory activities, making it a subject of interest in the development of natural dyes and therapeutic agents. Its stability and solubility characteristics can vary depending on the solvent used, which is an important consideration for its practical applications. Overall, cinerubin represents a fascinating example of how natural compounds can be harnessed for diverse uses in science and industry.
Formula:C42H51NO15
InChI:InChI=1/C42H51NO15/c1-8-42(51)17-28(32-21(36(42)41(50)52-7)15-22-33(38(32)48)39(49)35-26(46)10-9-25(45)34(35)37(22)47)57-31-16-23(43(5)6)40(20(4)55-31)58-30-14-12-27(19(3)54-30)56-29-13-11-24(44)18(2)53-29/h9-11,13,15,18-20,23,27-31,36,40,45-46,48,51H,8,12,14,16-17H2,1-7H3
Synonyms:
  • cinerubin R
  • methyl 2-ethyl-2,5,7,10-tetrahydroxy-6,11-dioxo-4-{[2,3,6-trideoxy-3-(dimethylamino)-4-O-{6-methyl-5-[(6-methyl-5-oxo-5,6-dihydro-2H-pyran-2-yl)oxy]tetrahydro-2H-pyran-2-yl}hexopyranosyl]oxy}-1,2,3,4,6,11-hexahydrotetracene-1-carboxylate
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Cinerubin R

    CAS:
    <p>Cinerubin R exhibits activity against Gram-positive bacteria and inhibits tumor cell activity, showing equivalent inhibitory effects on multidrug-resistant (MDR) cells and parent cells.</p>
    Formula:C42H51NO15
    Color and Shape:Solid
    Molecular weight:809.852