CAS 147664-83-3
:Citric-2,2,4,4-d4 Acid
Description:
Citric-2,2,4,4-d4 acid, with the CAS number 147664-83-3, is a deuterated form of citric acid, which is a tricarboxylic acid commonly found in citrus fruits. The "d4" in its name indicates that four hydrogen atoms in the citric acid molecule have been replaced with deuterium, a stable isotope of hydrogen. This modification enhances its utility in various scientific applications, particularly in nuclear magnetic resonance (NMR) spectroscopy, where deuterated compounds provide clearer spectra due to reduced background signals from hydrogen. Citric-2,2,4,4-d4 acid retains the characteristic properties of citric acid, including its sour taste and ability to act as a natural preservative and chelating agent. It is soluble in water and exhibits acidic properties, making it useful in biochemical research and as a standard in analytical chemistry. The presence of deuterium can also influence reaction kinetics and mechanisms, making it a valuable tool in studying metabolic pathways and chemical reactions.
Formula:C6H4D4O7
InChI:InChI=1/C6H8O7/c7-3(8)1-6(13,5(11)12)2-4(9)10/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/i1D2,2D2
SMILES:C(C(=O)O)(C(C(C(=O)O)([2H])[2H])(C(=O)O)O)([2H])[2H]
Synonyms:- 2-hydroxy(2H4)propane-1,2,3-tricarboxylic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Citric-2,2,4,4-d4 Acid
CAS:Formula:HOOCCD2C(COOH)(OH)CD2COOHPurity:98 atom % DColor and Shape:White SolidMolecular weight:196.05211Citric Acid-2,2,4,4-d4
CAS:Controlled Product<p>Applications Widely distributed in plants and in animal tissues and fluids. Produced by mycological fermentation on an industrial scale using crude sugar solutions, such as molasses and strains of Aspergillus niger.<br>References Gruber, C. M., et al.: J. Pharmacol. Exp. Ther., 94, 65 (1948),<br></p>Formula:C62H4H4O7Color and Shape:WhiteMolecular weight:196.15
