CAS 147695-92-9

N-(4-PHENYLSULFONYLPHENYL)-3,3,3-TRIFLUORO-2-HYDROXY-2-METHYLPROPANAMIDE

Description:

N-(4-Phenylsulfonyphenyl)-3,3,3-trifluoro-2-hydroxy-2-methylpropanamide, with CAS number 147695-92-9, is a synthetic organic compound characterized by its complex structure, which includes a trifluoromethyl group, a hydroxyl group, and a sulfonyl phenyl moiety. This compound typically exhibits properties such as high stability due to the presence of the trifluoromethyl group, which can enhance lipophilicity and influence its biological activity. The hydroxyl group contributes to its potential solubility in polar solvents, while the sulfonyl group may impart unique reactivity and interaction capabilities with biological targets. Such compounds are often investigated for their potential applications in pharmaceuticals, particularly in the development of drugs targeting specific biological pathways. The presence of multiple functional groups suggests that it may participate in various chemical reactions, making it a versatile candidate for further research in medicinal chemistry and related fields. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₆H₁₄F₃NO₄S

InChI: InChI=1/C16H14F3NO4S/c1-15(22,16(17,18)19)14(21)20-11-7-9-13(10-8-11)25(23,24)12-5-3-2-4-6-12/h2-10,22H,1H3,(H,20,21)

SMILES: CC(C(=O)Nc1ccc(cc1)S(=O)(=O)c1ccccc1)(C(F)(F)F)O

Synonyms:

• Zm 226600
• 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[4-(phenylsulfonyl)phenyl]propanamide

Propanamide, 3,3,3-trifluoro-2-hydroxy-2-methyl-N-[4-(phenylsulfonyl)phenyl]-

CAS: 147695-92-9

Formula: C₁₆H₁₄F₃NO₄S

Purity: 98%

Color and Shape: Solid

Molecular weight: 373.3469

Ref: IN-DA001F36

ZM 226600

CAS: 147695-92-9

ZM 226600

Purity: ≥98%

Molecular weight: 373.35g/mol

Ref: 54-BUP14539

ZM 226600

CAS: 147695-92-9

ZM 226600 is an ATP-sensitive potassium channel opener with an EC50 value of 500 nM. ZM226600 has an inhibitory effect on spontaneous bladder activity.

Formula: C₁₆H₁₄F₃NO₄S

Purity: 99.87%

Color and Shape: Solid

Molecular weight: 373.35

Ref: TM-T23563