CAS 14772-99-7
:Methyl (5β,7α,12α)-7,12-dihydroxy-3-oxocholan-24-oate
Description:
Methyl (5β,7α,12α)-7,12-dihydroxy-3-oxocholan-24-oate, commonly referred to as a bile acid derivative, is a chemical compound characterized by its steroidal structure, which includes a cholane backbone. This compound features multiple hydroxyl groups at the 7α and 12α positions, contributing to its polar nature and solubility in aqueous environments. The presence of a keto group at the 3-position and a methyl ester at the 24-position further defines its chemical reactivity and biological activity. This substance is known for its role in various biochemical processes, particularly in lipid metabolism and digestion, as it can influence the solubility and absorption of dietary fats. Its structural characteristics allow it to interact with biological membranes and proteins, making it significant in pharmacological and therapeutic contexts. Additionally, its CAS number, 14772-99-7, serves as a unique identifier for regulatory and research purposes, facilitating its study in various scientific disciplines, including biochemistry and medicinal chemistry.
Formula:C25H40O5
InChI:InChI=1S/C25H40O5/c1-14(5-8-22(29)30-4)17-6-7-18-23-19(13-21(28)25(17,18)3)24(2)10-9-16(26)11-15(24)12-20(23)27/h14-15,17-21,23,27-28H,5-13H2,1-4H3/t14-,15+,17-,18+,19+,20-,21+,23+,24+,25-/m1/s1
InChI key:InChIKey=CIZOGAIBGCZRCL-PXOOZVEKSA-N
SMILES:O[C@H]1[C@]2([C@]3([C@@](C)([C@@]([C@@H](CCC(OC)=O)C)(CC3)[H])[C@@H](O)C[C@@]2([C@]4(C)[C@](C1)(CC(=O)CC4)[H])[H])[H])[H]
Synonyms:- 5β-Cholan-24-oic acid, 7α,12α-dihydroxy-3-oxo-, methyl ester
- 5β-Cholanic acid, 7α,12α-dihydroxy-3-oxo-, methyl ester
- 7α,12α-Dihydroxy-3-oxo-5β-cholanic acid methyl ester
- Cholan-24-oic acid, 7,12-dihydroxy-3-oxo-, methyl ester, (5β,7α,12α)-
- Methyl (5Beta,7Alpha,8Xi,9Xi,10Xi,12Alpha,13Xi,14Xi,17Xi,20Xi)-7,12-Dihydroxy-3-Oxocholan-24-Oate
- Methyl (5β,7α,12α)-7,12-dihydroxy-3-oxocholan-24-oate
- Methyl 3-keto-7α,12α-dihydroxy-5β-cholanoate
- Methyl 3-oxoisodeoxycholate
- Methyl 7,12-Dihydroxy-3-Oxocholan-24-Oate
- Methyl 7alpha,12alpha-dihydroxy-3-oxo-5beta-cholan-24-oate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Cholic Acid Impurity 31
CAS:Formula:C25H40O5Color and Shape:White To Off-White SolidMolecular weight:420.59Methyl 3-Keto-7α,12α-dihydroxy-5β-cholanoate
CAS:Controlled ProductFormula:C25H40O5Color and Shape:NeatMolecular weight:420.58

