CAS 14773-40-1
:3-(3,4-Dimethoxyphenyl)-2-propenamide
Description:
3-(3,4-Dimethoxyphenyl)-2-propenamide, identified by its CAS number 14773-40-1, is an organic compound characterized by its amide functional group and a propenamide structure. This compound features a substituted phenyl ring with two methoxy groups at the 3 and 4 positions, which significantly influence its chemical properties and reactivity. The presence of the methoxy groups enhances the electron density on the aromatic ring, potentially affecting its reactivity in electrophilic aromatic substitution reactions. The propenamide moiety contributes to the compound's ability to participate in various chemical reactions, including those typical of unsaturated amides. This compound may exhibit biological activity, making it of interest in medicinal chemistry and pharmacology. Its solubility, stability, and reactivity can vary based on the solvent and environmental conditions. Overall, 3-(3,4-Dimethoxyphenyl)-2-propenamide is a versatile compound with potential applications in organic synthesis and drug development.
Formula:C11H13NO3
InChI:InChI=1S/C11H13NO3/c1-14-9-5-3-8(4-6-11(12)13)7-10(9)15-2/h3-7H,1-2H3,(H2,12,13)
InChI key:InChIKey=QUKZILHYXHKAKT-UHFFFAOYSA-N
SMILES:O(C)C1=C(OC)C=CC(C=CC(N)=O)=C1
Synonyms:- Cinnamamide, 3,4-dimethoxy-
- β-Carbamoyl-3,4-dimethoxystyrene
- 2-Propenamide, 3-(3,4-dimethoxyphenyl)-
- 3-(3,4-Dimethoxyphenyl)-2-propenamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
