CAS 1477517-20-6

(2R,3R)-4-(9-Anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-2-methyl-1,3-benzoxaphosphole

Description:

The chemical substance known as (2R,3R)-4-(9-Anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-2-methyl-1,3-benzoxaphosphole, with the CAS number 1477517-20-6, is a phosphole derivative characterized by its unique bicyclic structure that incorporates both phosphorus and oxygen within a five-membered ring. This compound features an anthracene moiety, which contributes to its potential applications in organic electronics and photonics due to the aromatic system's ability to facilitate charge transport. The presence of bulky substituents, such as the tert-butyl group, enhances its stability and solubility, making it suitable for various synthetic applications. Additionally, the stereochemistry indicated by the (2R,3R) configuration suggests specific spatial arrangements that may influence its reactivity and interaction with other molecules. Overall, this compound represents a fascinating area of study in organophosphorus chemistry, with implications for materials science and potential uses in advanced electronic devices.

Formula: C₂₆H₂₅OP

InChI: InChI=1S/C26H25OP/c1-17-27-23-15-9-14-22(25(23)28(17)26(2,3)4)24-20-12-7-5-10-18(20)16-19-11-6-8-13-21(19)24/h5-17H,1-4H3/t17-,28+/m1/s1

InChI key: InChIKey=YOXUHULUPBYLBU-UULLZXFKSA-N

SMILES: C(C)(C)(C)[P@@]1C2=C(C=3C4=C(C=C5C3C=CC=C5)C=CC=C4)C=CC=C2O[C@H]1C

Synonyms:

• (2R,3R)-4-(9-Anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-2-methyl-1,3-benzoxaphosphole
• 1,3-Benzoxaphosphole, 4-(9-anthracenyl)-3-(1,1-dimethylethyl)-2,3-dihydro-2-methyl-, (2R,3R)-

(2R,3R)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-methyl-2,3-dihydrobenzo[d][1,3]oxaphosphole, 97% (>99% ee)

CAS: 1477517-20-6

Formula: C₂₆H₂₅OP

Purity: 97% (>99% ee)

Color and Shape: light yellow solid

Molecular weight: 384.46

Ref: 08-15-6822

(2R,3R)-4-(anthracen-9-yl)-3-(tert-butyl)-2-methyl-2,3-dihydrobenzo[d][1,3]oxaphosphole

CAS: 1477517-20-6

Formula: C₂₆H₂₅OP

Purity: 97%

Color and Shape: Solid

Molecular weight: 384.4499

Ref: IN-DA01JN0W

(2R,3R)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-methyl-2,3-dihydrobenzo[d][1,3]oxaphosphole

CAS: 1477517-20-6

(2R,3R)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-methyl-2,3-dihydrobenzo[d][1,3]oxaphosphole

Purity: 97% 99%ee

Molecular weight: 384.46g/mol

Ref: 54-OR1066466

(2R,3R)-4-(Anthracen-9-yl)-3-(tert-butyl)-2-methyl-2,3-dihydrobenzo[d][1,3]oxaphosphole

CAS: 1477517-20-6

Purity: ≥97%,≥99%(ee)

Molecular weight: 384.4590149

Ref: 10-F604794