CAS 147780-39-0
:L-.alpha.-Aminoadipic acid-.delta.-methyl ester . HCl
Description:
L-alpha-Aminoadipic acid-delta-methyl ester hydrochloride, with the CAS number 147780-39-0, is a chemical compound that serves as an important intermediate in the synthesis of various pharmaceuticals and biochemical research applications. This compound is a derivative of amino acids, characterized by the presence of both an amino group and a carboxylic acid group, which contribute to its reactivity and solubility properties. The methyl ester functionality enhances its lipophilicity, making it more amenable for certain chemical reactions and biological interactions. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions, facilitating its use in laboratory settings. The compound is often utilized in studies related to metabolic pathways, enzyme activity, and as a building block in peptide synthesis. Its structural features allow it to participate in various chemical reactions, including esterification and amidation, making it a versatile reagent in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance.
Formula:C7H14ClNO4
InChI:InChI=1/C7H13NO4.ClH/c1-12-6(9)4-2-3-5(8)7(10)11;/h5H,2-4,8H2,1H3,(H,10,11);1H/t5-;/m0./s1
SMILES:COC(=O)CCC[C@@H](C(=O)O)N.Cl
Synonyms:- Hexanedioic acid, 2-amino-, 6-methyl ester, (2S)-, hydrochloride (1:1)
- H-Aad(Ome)-Oh Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Hexanedioic acid, 2-amino-, 6-methyl ester, hydrochloride, (S)- (9CI)
CAS:Formula:C7H14ClNO4Purity:95%Color and Shape:SolidMolecular weight:211.6434(2S)-2-Aminoadipic acid 6-methyl ester hydrochloride
CAS:(2S)-2-Aminoadipic acid 6-methyl ester hydrochloridePurity:97%Molecular weight:211.64g/molHexanedioic acid, 2-amino-, 6-methyl ester, hydrochloride, (S)- (9CI)
CAS:Purity:95%Molecular weight:211.64(S)-2-Aminohexanedioic Acid 6-Methyl Ester Hydrochloride
CAS:Controlled Product<p>Applications (S)-2-Aminohexanedioic Acid 6-Methyl Ester Hydrochloride is used to prepare amino acid containing thiophene derivatives as agonists for enhancing binding of integrin-expressing cells to integrin receptors.<br>References Biediger, R., et al.: PCT Int. Appl., WO 2012068251 A2 20120524 (2012)<br></p>Formula:C7H14ClNO4Color and Shape:NeatMolecular weight:211.64



