CAS 147808-42-2

5-Bromo-1,3-difluoro-2-nitrobenzene

Description:

5-Bromo-1,3-difluoro-2-nitrobenzene is an aromatic compound characterized by the presence of a bromine atom, two fluorine atoms, and a nitro group attached to a benzene ring. The molecular structure features a nitro group (-NO2) at the 2-position, which is an electron-withdrawing group, influencing the compound's reactivity and polarity. The bromine and fluorine substituents at the 5 and 1,3 positions, respectively, contribute to the compound's overall electronegativity and can affect its physical properties, such as boiling and melting points. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its unique combination of halogen and nitro functionalities makes it a valuable building block in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Safety data should be consulted, as halogenated compounds can exhibit toxicity and environmental persistence.

Formula: C₆H₂BrF₂NO₂

InChI: InChI=1/C6H2BrF2NO2/c7-3-1-4(8)6(10(11)12)5(9)2-3/h1-2H

SMILES: c1c(cc(c(c1F)N(=O)=O)F)Br

Synonyms:

• Benzene, 5-Bromo-1,3-Difluoro-2-Nitro-
• 1-Bromo-3,5-difluoro-4-nitrobenzene

Benzene, 5-bromo-1,3-difluoro-2-nitro-

CAS: 147808-42-2

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 237.9864

Ref: IN-DA001F7T

3,5-Difluoro-4-nitrobromobenzene

CAS: 147808-42-2

3,5-Difluoro-4-nitrobromobenzene

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: off white to green to dark grey crystalline solid

Molecular weight: 237.99g/mol

Ref: 54-PC57010

5-Bromo-1,3-difluoro-2-nitrobenzene

CAS: 147808-42-2

Formula: C₆H₂BrF₂NO₂

Purity: 98%

Color and Shape: Brown powder

Molecular weight: 237.988

Ref: 10-F077794