CAS 14785-95-6
:N-(6-amino-1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-5-pyrimidinyl)formamide
Description:
N-(6-amino-1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-5-pyrimidinyl)formamide, with the CAS number 14785-95-6, is a chemical compound that features a pyrimidine ring structure, which is characteristic of many biologically active molecules. This compound contains both amine and formamide functional groups, contributing to its potential reactivity and solubility in polar solvents. The presence of the tetrahydro structure indicates that it is a saturated derivative, which may influence its stability and interaction with biological systems. The dioxo groups suggest that it may participate in various chemical reactions, including those involving nucleophiles or electrophiles. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its specific properties, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound represents a unique structure that may have implications in medicinal chemistry and related fields.
Formula:C6H8N4O3
InChI:InChI=1/C6H8N4O3/c1-10-4(7)3(8-2-11)5(12)9-6(10)13/h2H,7H2,1H3,(H,8,11)(H,9,12,13)
InChI key:InChIKey=WIORCHCZQJVXLD-UHFFFAOYSA-N
SMILES:N(C=O)C1=C(N)N(C)C(=O)NC1=O
Synonyms:- 1-Methyl-5-(formylamino)-6-aminouracil
- 3-Methyl-4-amino-5-(formylamino)uracil
- Formamide, N-(6-amino-1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-5-pyrimidinyl)-
- N-(6-amino-1-methyl-2,4-dioxo-1,2,3,4-tetrahydropyrimidin-5-yl)formamide
- NSC 81446
- N-(6-Amino-1,2,3,4-tetrahydro-1-methyl-2,4-dioxo-5-pyrimidinyl)formamide
- Linagliptin Impurity 74
- N-(6-Amino-1,2,3,4-tetrahydro-1-methyl-2,4-dioxopyrimidin-5-yl)formamide
- N-(6-amino-1-methyl-2,4-dioxopyrimidin-5-yl)formamide
- Einecs 238-853-8
- LigliptinImpurity74
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
6-Amino-5-formylamino-1-methyluracil
CAS:Controlled ProductFormula:C6H8N4O3Color and Shape:NeatMolecular weight:184.153


