CAS 147852-26-4: 2-ethoxy-4-[2-({(1R)-3-methyl-1-[2-(piperidin-1-yl)phenyl]butyl}amino)-2-oxoethyl]benzoic acid
Description:2-Ethoxy-4-[2-({(1R)-3-methyl-1-[2-(piperidin-1-yl)phenyl]butyl}amino)-2-oxoethyl]benzoic acid, with CAS number 147852-26-4, is a complex organic compound characterized by its multi-functional structure. It features a benzoic acid moiety, which contributes to its acidic properties, and an ethoxy group that enhances its solubility in organic solvents. The presence of a piperidine ring suggests potential interactions with biological systems, making it of interest in medicinal chemistry. The compound's structure includes a chiral center, indicating that it may exhibit stereoisomerism, which can influence its pharmacological activity. Additionally, the presence of an amino group and a ketone functionality indicates potential for hydrogen bonding and reactivity, which can be significant in drug design and synthesis. Overall, this compound's unique structural features may contribute to its potential applications in pharmaceuticals, particularly in the development of therapeutic agents targeting specific biological pathways.
Formula:C27H36N2O4
InChI:InChI=1/C27H36N2O4/c1-4-33-25-17-20(12-13-22(25)27(31)32)18-26(30)28-23(16-19(2)3)21-10-6-7-11-24(21)29-14-8-5-9-15-29/h6-7,10-13,17,19,23H,4-5,8-9,14-16,18H2,1-3H3,(H,28,30)(H,31,32)/t23-/m1/s1
- Synonyms:
- benzoic acid, 2-ethoxy-4-[2-[[(1R)-3-methyl-1-[2-(1-piperidinyl)phenyl]butyl]amino]-2-oxoethyl]-