CymitQuimica logo

CAS 147906-04-5

:

N-benzyl-4-methyl-cyclohexanamine hydrochloride

Description:
N-benzyl-4-methyl-cyclohexanamine hydrochloride is a chemical compound characterized by its amine functional group and a cyclohexane ring structure. It features a benzyl group and a methyl substituent on the cyclohexane, which contributes to its unique properties. This compound is typically encountered as a hydrochloride salt, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amine group suggests potential basicity, allowing it to participate in various chemical reactions, including alkylation and acylation. Its structural features may influence its biological activity, making it of interest in medicinal chemistry. Additionally, the compound's molecular weight, melting point, and specific reactivity can vary based on its purity and the conditions under which it is handled. As with many amines, it may exhibit basic properties and can form salts with acids, which is relevant for its storage and application in laboratory settings. Safety data should be consulted for handling and potential hazards associated with this compound.
Formula:C14H22ClN
InChI:InChI=1/C14H21N.ClH/c1-12-7-9-14(10-8-12)15-11-13-5-3-2-4-6-13;/h2-6,12,14-15H,7-11H2,1H3;1H
SMILES:CC1CCC(CC1)NCc1ccccc1.Cl
Synonyms:
  • N-Benzyl-4-methylcyclohexanamine hydrochloride (1:1)
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.