CAS 14793-00-1

IMIDAZO[1,2-B]PYRIDAZINE, 6-CHLORO-2-METHYL-

Description:

Imidazo[1,2-b]pyridazine, 6-chloro-2-methyl- is a heterocyclic compound characterized by its fused imidazole and pyridazine rings, which contribute to its unique chemical properties. The presence of a chlorine atom at the 6-position and a methyl group at the 2-position of the pyridazine ring influences its reactivity and solubility. This compound typically exhibits moderate polarity, making it soluble in various organic solvents while being less soluble in water. Its structure allows for potential biological activity, which is of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the presence of functional groups. Additionally, its stability can be affected by environmental conditions such as pH and temperature. Overall, imidazo[1,2-b]pyridazine derivatives are studied for their potential applications in drug discovery and development, as well as in materials science.

Formula: C₇H₆ClN₃

InChI: InChI=1/C7H6ClN3/c1-5-4-11-7(9-5)3-2-6(8)10-11/h2-4H,1H3

SMILES: Cc1cn2c(ccc(Cl)n2)n1

Synonyms:

• 6-Chloro-2-Methylimidazo[1,2-B]Pyridazine

IMIDAZO[1,2-B]PYRIDAZINE, 6-CHLORO-2-METHYL-

CAS: 14793-00-1

Formula: C₇H₆ClN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 167.5956

Ref: IN-DA001FB1

6-Chloro-2-methylimidazo[1,2-b]pyridazine

CAS: 14793-00-1

6-Chloro-2-methylimidazo[1,2-b]pyridazine

Purity: 98%

Molecular weight: 167.60g/mol

Ref: 54-OR927789

6-Chloro-2-methylimidazo[1,2-b]pyridazine

CAS: 14793-00-1

Formula: C₇H₆ClN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 167.6

Ref: 10-F235095