CAS 147992-28-7

4-(Difluoromethoxy)benzamide

Description:

4-(Difluoromethoxy)benzamide is an organic compound characterized by the presence of a benzamide functional group substituted with a difluoromethoxy group at the para position. This compound features a benzene ring, which contributes to its aromatic properties, and the difluoromethoxy group, which consists of a methoxy group (–OCH3) where two hydrogen atoms are replaced by fluorine atoms. The presence of fluorine atoms typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. 4-(Difluoromethoxy)benzamide may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the compound's stability and solubility characteristics can be influenced by the difluoromethoxy substitution, which may affect its interactions in various chemical environments. Overall, this compound represents a unique combination of functional groups that can be explored for various chemical and biological applications.

Formula: C₈H₇F₂NO₂

InChI: InChI=1S/C8H7F2NO2/c9-8(10)13-6-3-1-5(2-4-6)7(11)12/h1-4,8H,(H2,11,12)

InChI key: InChIKey=HCQDUYGHJUQQAD-UHFFFAOYSA-N

SMILES: O(C(F)F)C1=CC=C(C(N)=O)C=C1

Synonyms:

• 4-(Difluoromethoxy)benzamide
• Benzamide, 4-(difluoromethoxy)-

4-(Difluoromethoxy)benzamide

CAS: 147992-28-7

4-(Difluoromethoxy)benzamide is an intermediate in the synthesis of roflumilast, which is a drug used to treat asthma. This intermediate is produced by condensation of methoxybenzoic acid with benzaldehyde and hydrochloric acid. The product can be purified by recrystallization or by conversion to its n-oxide, which has advantages over the chloride form because it is easier to handle and has less impurities. 4-(Difluoromethoxy)benzamide can be used in the industrial production of roflumilast, as it reacts quickly and easily with other chemicals.

Formula: C₈H₇F₂NO₂

Purity: Min. 95%

Molecular weight: 187.14 g/mol

Ref: 3D-XFA99228