CAS 148-25-4
:4,5-dihydroxynaphthalene-2,7-disulphonic acid
Description:
4,5-Dihydroxynaphthalene-2,7-disulphonic acid, with the CAS number 148-25-4, is an organic compound that belongs to the class of naphthalene derivatives. It features two hydroxyl groups and two sulfonic acid groups, which contribute to its solubility in water and its ability to act as a strong acid. This compound is typically a solid at room temperature and is known for its high stability under various conditions. Its structure allows for potential applications in dye manufacturing, particularly in the production of azo dyes, due to its ability to form complex structures with metal ions. Additionally, the presence of multiple functional groups enhances its reactivity, making it useful in various chemical syntheses. The sulfonic acid groups impart significant polarity, facilitating interactions with other polar substances. Overall, 4,5-dihydroxynaphthalene-2,7-disulphonic acid is a versatile compound with important implications in both industrial and research settings.
Formula:C10H8O8S2
InChI:InChI=1S/C10H8O8S2/c11-8-3-6(19(13,14)15)1-5-2-7(20(16,17)18)4-9(12)10(5)8/h1-4,11-12H,(H,13,14,15)(H,16,17,18)
InChI key:InChIKey=HLVXFWDLRHCZEI-UHFFFAOYSA-N
SMILES:OC=1C2=C(C=C(S(=O)(=O)O)C=C2O)C=C(S(=O)(=O)O)C1
Synonyms:- 1,8-Dihydroxynaphthalene-3,6-disulfonic acid
- 1,8-Dihydroxynaphthylene-3,6-Disulfonic Acid
- 2,7-Naphthalenedisulfonic acid, 4,5-dihydroxy-
- 4,5-Dihydroxy-2,7-Naphthalenedisulfonic Acid
- 4,5-Dihydroxy-2,7-naphthalene disulfonic acid
- 4,5-Dihydroxynaphthalene-2,7-Disulfonic Acid
- 4,5-Dihydroxynaphthalin-2,7-disulfonsaure
- Acide 4,5-dihydroxynaphtalene-2,7-disulfonique
- Acido 4,5-Dihidroxinaftaleno-2,7-Disulfonico
- Chromatropic acid
- Chromotropic acid
- Naphthalene-3,6-Disulfonic Acid, 1,8-Dihydroxy-
- C.I. 16655
- 4,5-dihydroxy-7-naphthalenedisulfonicacid
- TIMTEC-BB SBB001312
- 4,5-dihydroxynaphthalene-2,7-disulphonic acid
- CHROMOGEN
- Chrmotropicacid
- Chromotopic acid
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,7-Naphthalenedisulfonic acid, 4,5-dihydroxy-
CAS:Formula:C10H8O8S2Purity:99%Color and Shape:SolidMolecular weight:320.29574,5-Dihydroxy-2,7-Naphthalenedisulfonic Acid
CAS:4,5-Dihydroxy-2,7-Naphthalenedisulfonic AcidPurity:ARMolecular weight:320.3g/mol1,8-Dihydroxynaphthylene-3,6-disulfonic acid
CAS:1,8-Dihydroxynaphthylene-3,6-disulfonic acid is a sulfonic acid that has been shown to be an effective biocide for wastewater treatment. It has the ability to form stable complexes with organic matter and is not readily degraded by chemical reactions. 1,8-Dihydroxynaphthylene-3,6-disulfonic acid has been shown to have a strong affinity for certain metals and can be used to remove them from wastewater. This compound is also able to form stable complexes with metal ions in solution, which leads to the removal of these metals from the water column. The optimum concentration of 1,8-dihydroxynaphthylene-3,6-disulfonic acid varies depending on the specific metal being targeted and ranges from 0.01% to 0.1%.Formula:C10H8O8S2Purity:Min. 95%Color and Shape:White PowderMolecular weight:320.3 g/mol4,5-Dihydroxynaphthalene-2,7-disulfonic acid
CAS:Formula:C10H8O8S2Purity:95.0%Color and Shape:SolidMolecular weight:320.29



