CymitQuimica logo

CAS 1480-64-4

:

3-Chloro-2-fluoro-pyridine

Description:
3-Chloro-2-fluoro-pyridine is a heterocyclic aromatic compound characterized by a pyridine ring substituted with both chlorine and fluorine atoms. The chlorine atom is located at the 3-position, while the fluorine atom is at the 2-position of the pyridine ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. It is known for its moderate polarity and can engage in various chemical reactions typical of halogenated pyridines, such as nucleophilic substitutions and electrophilic aromatic substitutions. The presence of both halogens can influence its reactivity and solubility in organic solvents. 3-Chloro-2-fluoro-pyridine is often used in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals due to its unique electronic properties and ability to act as a building block in organic synthesis. Safety precautions should be taken when handling this compound, as it may pose health risks through inhalation or skin contact.
Formula:C5H3ClFN
InChI:InChI=1/C5H3ClFN/c6-4-2-1-3-8-5(4)7/h1-3H
InChI key:IHGMHTQDGNVKTA-UHFFFAOYSA-N
SMILES:c1cc(c(F)nc1)Cl
Synonyms:
  • 3-Chloro-2-Fluoropyridine
  • 2-Fluoro-3-chloro pyridine
Found 5 products.