CAS 1480-87-1
:2-Fluoro-3-nitropyridine
Description:
2-Fluoro-3-nitropyridine is a heterocyclic aromatic compound characterized by the presence of both a fluorine atom and a nitro group attached to a pyridine ring. The fluorine atom is located at the second position, while the nitro group is at the third position of the pyridine ring, which consists of a six-membered ring containing five carbon atoms and one nitrogen atom. This compound typically appears as a yellow to brown solid and is known for its polar nature due to the electronegative fluorine and nitro groups, which can influence its reactivity and solubility in various solvents. It is often used in organic synthesis and as an intermediate in the production of pharmaceuticals and agrochemicals. The presence of the nitro group can also impart specific reactivity, making it a valuable building block in the synthesis of more complex molecules. Safety precautions should be taken when handling this compound, as it may pose health risks if inhaled or ingested.
Formula:C5H3FN2O2
InChI:InChI=1/C5H3FN2O2/c6-5-4(8(9)10)2-1-3-7-5/h1-3H
SMILES:c1cc(c(F)nc1)N(=O)=O
Synonyms:- Pyridine, 2-fluoro-3-nitro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
2-Fluoro-3-nitropyridine
CAS:Formula:C5H3FN2O2Purity:>98.0%(GC)Color and Shape:Light yellow to Yellow to Orange clear liquidMolecular weight:142.092-Fluoro-3-nitropyridine, 98%
CAS:2-Fluoro-3-nitropyridine is used as a pharmaceutical intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU refereFormula:C5H3FN2O2Purity:98%Molecular weight:142.092-Fluoro-3-nitropyridine
CAS:Formula:C5H3FN2O2Purity:97%Color and Shape:LiquidMolecular weight:142.08792-Fluoro-3-nitropyridine
CAS:2-Fluoro-3-nitropyridineFormula:C5H3FN2O2Purity:95%Color and Shape: light yellow low melting solidMolecular weight:142.09g/mol2-Fluoro-3-nitro-pyridine
CAS:Formula:C5H3FN2O2Purity:97%Color and Shape:Solid, ClearMolecular weight:142.089




