CymitQuimica logo

CAS 148018-34-2

:

4-Chloroquinoline-6-carboxylicacidethylester

Description:
4-Chloroquinoline-6-carboxylic acid ethyl ester is a chemical compound characterized by its quinoline structure, which consists of a bicyclic aromatic system containing a nitrogen atom. This compound features a chloro substituent at the 4-position and an ethyl ester functional group at the 6-position of the quinoline ring. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chloro group can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The ethyl ester moiety can also participate in esterification and hydrolysis reactions. This compound may be of interest in medicinal chemistry due to its structural similarity to other biologically active quinoline derivatives, which have been studied for their antimicrobial, anti-inflammatory, and anticancer properties. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C12H10ClNO2
InChI:InChI=1S/C12H10ClNO2/c1-2-16-12(15)8-3-4-11-9(7-8)10(13)5-6-14-11/h3-7H,2H2,1H3
InChI key:CAYFWSPVKHFLJV-UHFFFAOYSA-N
SMILES:CCOC(=O)C1=CC2=C(C=CN=C2C=C1)Cl
Synonyms:
  • 4-Chloroquinoline-6-Carboxylic Acid Ethyl Ester
Found 4 products.