CAS 148038-83-9

6-BROMO-1H-IMIDAZO[4,5-B]PYRIDIN-2(3H)-ONE

Description:

6-Bromo-1H-imidazo[4,5-b]pyridin-2(3H)-one is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 6-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a solid state at room temperature and is soluble in polar organic solvents. Its molecular structure includes a carbonyl group, which can participate in hydrogen bonding and may affect its interaction with biological targets. The compound is of interest in medicinal chemistry, particularly for its potential pharmacological applications, including antimicrobial and anticancer activities. Additionally, its structural features allow for various synthetic modifications, making it a valuable scaffold in drug design. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-bromo-1H-imidazo[4,5-b]pyridin-2(3H)-one represents a significant compound in the field of organic and medicinal chemistry.

Formula: C₆H₄BrN₃O

InChI: InChI=1/C6H4BrN3O/c7-3-1-4-5(8-2-3)10-6(11)9-4/h1-2H,(H2,8,9,10,11)

SMILES: c1c(cnc2c1nc([nH]2)O)Br

Synonyms:

• 6-Bromo-1,3-Dihydro-2H-Imidazo[4,5-B]Pyridin-2-One

2H-Imidazo[4,5-b]pyridin-2-one, 6-bromo-1,3-dihydro-

CAS: 148038-83-9

Formula: C₆H₄BrN₃O

Purity: 95%

Color and Shape: Solid

Molecular weight: 214.0195

Ref: IN-DA001FE0

6-Bromo-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

CAS: 148038-83-9

6-Bromo-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

Formula: C₆H₄BrN₃O

Purity: ≥95%

Color and Shape: Brown Solid

Molecular weight: 214.02g/mol

Ref: 54-OR303626

6-Bromo-1,3-dihydro-2H-imidazo[4,5-b]pyridin-2-one

CAS: 148038-83-9

Formula: C₆H₄BrN₃O

Purity: 97%

Color and Shape: Solid

Molecular weight: 214.022

Ref: 10-F067586