CAS 14804-27-4
:5-Chloro-2-methoxy-1,3-dimethylbenzene
Description:
5-Chloro-2-methoxy-1,3-dimethylbenzene, also known as 5-chloro-o-anisidine, is an aromatic compound characterized by the presence of a chlorine atom and a methoxy group attached to a dimethyl-substituted benzene ring. Its molecular structure features a six-membered carbon ring with substituents that influence its chemical properties, including reactivity and solubility. This compound typically exhibits a moderate boiling point and melting point, indicative of its aromatic nature. It is generally soluble in organic solvents but has limited solubility in water due to its hydrophobic characteristics. The presence of the chlorine atom can enhance its electrophilic reactivity, making it useful in various chemical syntheses. Additionally, the methoxy group can participate in hydrogen bonding, affecting its physical properties. Safety considerations are important, as halogenated compounds can pose environmental and health risks. Overall, 5-Chloro-2-methoxy-1,3-dimethylbenzene is significant in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals.
Formula:C9H11ClO
InChI:InChI=1S/C9H11ClO/c1-6-4-8(10)5-7(2)9(6)11-3/h4-5H,1-3H3
InChI key:InChIKey=MXAOCQCPDIIBGZ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C)C=C(Cl)C=C1C
Synonyms:- 5-Chloro-2-methoxy-1,3-dimethylbenzene
- 4-Chloro-2,6-dimethylanisole
- Benzene, 5-chloro-2-methoxy-1,3-dimethyl-
- Anisole, 4-chloro-2,6-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
