CAS 14806-72-5
:Triethanolamine acetate
Description:
Triethanolamine acetate is an organic compound that serves as a salt formed from triethanolamine and acetic acid. It is characterized by its colorless to pale yellow appearance and is typically hygroscopic, meaning it can absorb moisture from the air. This compound is soluble in water, which makes it useful in various applications, particularly in the cosmetic and pharmaceutical industries. Triethanolamine acetate acts as a surfactant, emulsifier, and pH balancer, contributing to the stability and texture of formulations. It is also known for its mildness, making it suitable for sensitive skin products. In addition to its cosmetic uses, it may find applications in industrial processes, such as in the formulation of detergents and cleaning agents. Safety data indicates that while it is generally considered safe for use in regulated amounts, it is advisable to handle it with care, as with any chemical substance, to avoid potential irritation or adverse reactions.
Formula:C6H15NO3·C2H4O2
InChI:InChI=1S/C6H15NO3.C2H4O2/c8-4-1-7(2-5-9)3-6-10;1-2(3)4/h8-10H,1-6H2;1H3,(H,3,4)
InChI key:InChIKey=UPCXAARSWVHVLY-UHFFFAOYSA-N
SMILES:N(CCO)(CCO)CCO.C(C)(O)=O
Synonyms:- Ethanol, 2,2′,2′′-nitrilotris-, acetate (salt)
- Ethanol, 2,2′,2′′-nitrilotri-, acetate (salt)
- Ethanol, 2,2′,2′′-nitrilotri-, acetate
- Ethanol, 2,2′,2′′-nitrilotris-, acetate (1:1)
- Triethanolamine acetate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
