CAS 148081-72-5: HTHQ
Description:HTHQ, or 1-Hydroxy-2-(hydroxymethyl)-2-methylpropan-1-one, is a chemical compound characterized by its multifunctional hydroxyl groups, which contribute to its reactivity and solubility in polar solvents. It typically appears as a colorless to pale yellow liquid or solid, depending on its form and purity. HTHQ is known for its role as a building block in organic synthesis, particularly in the production of various polymers and resins. Its structure allows for hydrogen bonding, enhancing its interactions with other molecules, which can influence its physical properties such as boiling point and viscosity. Additionally, HTHQ may exhibit mild toxicity, necessitating careful handling and appropriate safety measures during use. Its applications span across industries, including pharmaceuticals, where it may serve as an intermediate in drug synthesis, and in the formulation of coatings and adhesives. As with any chemical substance, understanding its properties and potential hazards is crucial for safe and effective utilization in various applications.
Formula:C15H24O2
InChI:InChI=1S/C15H24O2/c1-5-6-7-8-9-17-14-10-11(2)15(16)13(4)12(14)3/h10,16H,5-9H2,1-4H3
InChI key:InChIKey=ATMNQRRJNBCQJO-UHFFFAOYSA-N
SMILES:OC=1C(=CC(OCCCCCC)=C(C1C)C)C
- Synonyms:
- 4-(Hexyloxy)-2,3,6-trimethylphenol
- Ccris 7478
- Phenol, 4-(hexyloxy)-2,3,6-trimethyl-
- HTHQ
- 1-O-Hexyl-2,3,5-trimethylhydroquinone
