CAS 1481-21-6

2-bromo-3,4,6-trifluoroaniline

Description:

2-Bromo-3,4,6-trifluoroaniline is an aromatic amine characterized by the presence of a bromine atom and three fluorine atoms attached to a benzene ring that also contains an amino group (-NH2). This compound is typically a solid at room temperature and exhibits a pale yellow to white appearance. Its molecular structure contributes to its unique chemical properties, including its reactivity and solubility in various organic solvents. The presence of electronegative fluorine atoms significantly influences its electronic properties, making it a strong candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the bromine substituent can participate in further reactions, enhancing its utility in synthetic organic chemistry. Due to its functional groups, 2-bromo-3,4,6-trifluoroaniline may exhibit biological activity, making it of interest in pharmaceutical research. However, handling this compound requires caution due to potential toxicity associated with aromatic amines. Proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₆H₃BrF₃N

InChI: InChI=1/C6H3BrF3N/c7-4-5(10)2(8)1-3(9)6(4)11/h1H,11H2

SMILES: c1c(c(c(c(c1F)N)Br)F)F

Benzenamine, 2-bromo-3,4,6-trifluoro-

CAS: 1481-21-6

Formula: C₆H₃BrF₃N

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.9939

Ref: IN-DA001FFQ

2-Bromo-3,4,6-trifluoroaniline

CAS: 1481-21-6

2-Bromo-3,4,6-trifluoroaniline

Purity: 99%

Molecular weight: 225.995g/mol

Ref: 54-PC103962

2-Bromo-3,4,6-trifluoroaniline

CAS: 1481-21-6

Formula: C₆H₃BrF₃N

Purity: 98%

Color and Shape: Solid

Molecular weight: 225.996

Ref: 10-F035113