CAS 1481-41-0
:3,3,3-Trifluoropropyldimethylchlorosilane
Description:
3,3,3-Trifluoropropyldimethylchlorosilane, with the CAS number 1481-41-0, is an organosilicon compound characterized by the presence of a silicon atom bonded to two methyl groups, a chlorine atom, and a trifluoropropyl group. This compound is typically a colorless liquid with a distinctive odor, and it is known for its reactivity due to the presence of the chlorosilane functional group. It is used in various applications, including as a silane coupling agent, which enhances adhesion between organic materials and inorganic substrates. The trifluoropropyl group imparts unique properties, such as increased hydrophobicity and thermal stability, making it valuable in coatings and surface treatments. Additionally, the presence of fluorine atoms contributes to its chemical stability and resistance to degradation. However, handling this compound requires caution due to its potential reactivity and the release of hydrochloric acid upon hydrolysis. Proper safety measures should be observed when working with this substance in laboratory or industrial settings.
Formula:C5H10ClF3Si
InChI:InChI=1S/C5H10ClF3Si/c1-10(2,6)4-3-5(7,8)9/h3-4H2,1-2H3
InChI key:InChIKey=KBAZUXSLKGQRJF-UHFFFAOYSA-N
SMILES:C(C[Si](C)(C)Cl)C(F)(F)F
Synonyms:- (3,3,3-Trifluoropropyl)chlorodimethylsilane
- (3,3,3-Trifluoropropyl)dimethylsilyl chloride
- 3,3,3-Trifluoropropyldimethylchlorosilane
- Chlorodimethyl(3,3,3-trifluoropropyl)silane
- Dimethyl(3,3,3-Trifluoropropyl)Chloro-Silane
- Silane, chlorodimethyl(3,3,3-trifluoropropyl)-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Silane, chlorodimethyl(3,3,3-trifluoropropyl)-
CAS:Formula:C5H10ClF3SiPurity:95%Color and Shape:LiquidMolecular weight:190.6666(3,3,3-Trifluoropropyl)chlorodimethylsilane
CAS:(3,3,3-Trifluoropropyl)chlorodimethylsilaneFormula:C5H10ClF3SiPurity:95%Color and Shape: clear. brown liquidMolecular weight:190.6666g/mol(3,3,3-Trifluoropropyl)dimethylchlorosilane
CAS:Purity:90%Color and Shape:LiquidMolecular weight:190.6699981689453(3,3,3-TRIFLUOROPROPYL)DIMETHYLCHLOROSILANE
CAS:Formula:C5H10ClF3SiPurity:97%Color and Shape:Straw LiquidMolecular weight:190.67Chlorodimethyl-3,3,3-trifluoropropylsilane
CAS:Chlorodimethyl-3,3,3-trifluoropropylsilane is a hydroxy group containing organic solvent that is used in the production of particle coatings. It can be used as a reactive diluent for silicon and nitrogen compounds. The average particle diameter of this product is about 1 micron. Chlorodimethyl-3,3,3-trifluoropropylsilane reacts with oxygen and nitrogen to form a monolayer which can be deposited on various surfaces. This product has an anti-reflection effect on coated objects because the coating particles scatter light from the surface below the coating.Formula:C5H10ClF3SiPurity:Min. 95%Molecular weight:190.67 g/mol




