CAS 1481-63-6

1-Bromo-2,4-dichloro-5-fluorobenzene

Description:

1-Bromo-2,4-dichloro-5-fluorobenzene is an aromatic halogenated compound characterized by the presence of multiple halogen substituents on a benzene ring. Specifically, it features one bromine atom, two chlorine atoms, and one fluorine atom attached to the benzene structure. This compound is typically a colorless to pale yellow liquid or solid, depending on temperature and purity. It is known for its relatively low solubility in water but is soluble in organic solvents such as ethanol and acetone. The presence of multiple halogens contributes to its chemical reactivity, making it useful in various synthetic applications, including the production of pharmaceuticals and agrochemicals. Additionally, the compound may exhibit significant biological activity, which can be of interest in medicinal chemistry. Safety considerations are important when handling this substance, as halogenated compounds can pose environmental and health risks. Proper storage and disposal methods should be followed to mitigate any potential hazards associated with its use.

Formula: C₆H₂BrCl₂F

InChI: InChI=1/C6H2BrCl2F/c7-3-1-6(10)5(9)2-4(3)8/h1-2H

SMILES: c1c(c(cc(c1F)Cl)Cl)Br

Synonyms:

• 5-Bromo-2,4-dichlorofluorobenzene

Benzene, 1-bromo-2,4-dichloro-5-fluoro-

CAS: 1481-63-6

Formula: C₆H₂BrCl₂F

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.8885

Ref: IN-DA001FGB

1-Bromo-2,4-dichloro-5-fluorobenzene

CAS: 1481-63-6

1-Bromo-2,4-dichloro-5-fluorobenzene

Purity: 97%

Molecular weight: 243.89g/mol

Ref: 54-PC103923

2,4-Dichloro-5-fluorobromobenzene

CAS: 1481-63-6

Formula: C₆H₂BrCl₂F

Purity: 97%

Color and Shape: Solid

Molecular weight: 243.88

Ref: 10-F035699