CAS 1481-99-8
:SPIRO[5.5]UNDECANE-2,4-DIONE
Description:
Spiro[5.5]undecane-2,4-dione, with the CAS number 1481-99-8, is a bicyclic organic compound characterized by its unique spiro structure, which consists of two fused rings sharing a single carbon atom. This compound features two ketone functional groups located at the 2 and 4 positions of the undecane backbone, contributing to its reactivity and potential applications in organic synthesis. The spiro configuration imparts distinctive stereochemical properties, influencing its physical and chemical behavior. Typically, compounds of this nature exhibit moderate solubility in organic solvents and may have specific melting and boiling points influenced by their molecular structure. The presence of the diketone functionality suggests potential for undergoing various chemical reactions, such as nucleophilic addition or condensation reactions. Additionally, spiro compounds are of interest in medicinal chemistry and materials science due to their unique structural properties, which can lead to interesting biological activities and applications in the development of novel materials. Overall, spiro[5.5]undecane-2,4-dione represents a fascinating subject for further research in organic chemistry.
Formula:C11H16O2
InChI:InChI=1/C11H16O2/c12-9-6-10(13)8-11(7-9)4-2-1-3-5-11/h1-8H2
SMILES:C1CCC2(CC1)CC(=O)CC(=O)C2
Synonyms:- Iflab-Bb F2124-0756
- 4-Hydroxyspiro[5.5]Undec-3-En-2-One
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Spiro[5.5]undecane-2,4-dione
CAS:Controlled ProductFormula:C11H16O2Color and Shape:NeatMolecular weight:180.244Spiro[5.5]undecane-2,4-dione
CAS:Spiro[5.5]undecane-2,4-dione is an analgesic drug that belongs to the class of carboxylic acid derivatives. It has been shown to be effective in treating chronic pain and neuropathic pain. Spiro[5.5]undecane-2,4-dione binds to a pharmacophore site on voltage gated sodium channels, preventing the influx of sodium ions into the cell, which blocks the conduction of nerve impulses and relieves pain. The chemical structure of Spiro[5.5]undecane-2,4-dione is similar to that of morphine but it does not have morphine's addictive properties or potential for abuse.
Formula:C11H16O2Purity:Min. 95%Molecular weight:180.25 g/mol



