CymitQuimica logo

CAS 148101-51-3

:

AC-LYS(FMOC)-OH

Description:
AC-LYS(FMOC)-OH, also known as Fmoc-Lysine, is a protected form of the amino acid lysine, commonly used in peptide synthesis. The "AC" prefix indicates the presence of an acetyl group, which enhances the solubility and stability of the compound. The "FMOC" (9-fluorenylmethoxycarbonyl) group serves as a protective group for the amino functionality, allowing for selective reactions during peptide assembly while preventing unwanted side reactions. This compound is typically white to off-white in appearance and is soluble in organic solvents such as dimethyl sulfoxide (DMSO) and dimethylformamide (DMF), but less soluble in water. AC-LYS(FMOC)-OH is crucial in solid-phase peptide synthesis, where it facilitates the stepwise addition of amino acids to form peptides. Its stability under various conditions makes it a valuable intermediate in the synthesis of biologically active peptides and proteins. Proper handling and storage are essential to maintain its integrity, as exposure to moisture and light can lead to degradation.
Formula:C23H26N2O5
InChI:InChI=1S/C23H26N2O5/c1-15(26)25-21(22(27)28)12-6-7-13-24-23(29)30-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20/h2-5,8-11,20-21H,6-7,12-14H2,1H3,(H,24,29)(H,25,26)(H,27,28)/t21-/m0/s1
InChI key:HPXGLFPXINBZFY-NRFANRHFSA-N
SMILES:CC(=O)N[C@@H](CCCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)O
Found 5 products.