CAS 14813-19-5
:2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one
Description:
2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one, with the CAS number 14813-19-5, is a synthetic organic compound belonging to the class of flavonoids. This compound features a complex structure characterized by a benzopyran core, which is a fused ring system comprising a benzene ring and a pyran ring. The presence of multiple methoxy groups (–OCH3) on the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound is typically characterized by its yellow to orange color, which is common among flavonoids, and it may exhibit fluorescence under UV light. Its solubility is generally higher in organic solvents compared to water, reflecting its hydrophobic nature. Due to its structural features, it may possess antioxidant, anti-inflammatory, or other pharmacological activities, making it of interest in medicinal chemistry and natural product research. However, specific biological activities and applications would require further investigation through empirical studies.
Formula:C19H18O6
InChI:InChI=1S/C19H18O6/c1-21-12-6-5-7-13(22-2)18(12)16-10-11(20)17-14(25-16)8-9-15(23-3)19(17)24-4/h5-10H,1-4H3
InChI key:InChIKey=PBQMALAAFQMDSP-UHFFFAOYSA-N
SMILES:O(C)C1=C(C(OC)=CC=C1)C=2OC=3C(C(=O)C2)=C(OC)C(OC)=CC3
Synonyms:- Zapotin
- 2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-1-benzopyran-4-one
- Flavone, 2′,5,6,6′-tetramethoxy-
- 2-(2,6-Dimethoxyphenyl)-5,6-dimethoxy-4H-chromen-4-one
- 4H-1-Benzopyran-4-one, 2-(2,6-dimethoxyphenyl)-5,6-dimethoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
4H-1-Benzopyran-4-one, 2-(2,6-dimethoxyphenyl)-5,6-dimethoxy-
CAS:Formula:C19H18O6Purity:95%+Color and Shape:SolidMolecular weight:342.3426Zapotin
CAS:Zapotin is a natural polyhydroxylated flavonoid that inhibits K562 cells, E. coli, and HIV-1 RT RNase H, exhibiting antioxidant, antiviral, antibacterial, anticonvulsant, anticancer, anxiolytic, antifungal, and antidepressant-like activities.Formula:C19H18O6Purity:98.8%Color and Shape:SolidMolecular weight:342.34Zapotin
CAS:Zapotin is a natural compound, which is sourced from the seeds of the Sapote Blanco (Casimiroa edulis). This organic compound exhibits its mode of action primarily through its interaction with cancerous cells. Zapotin induces apoptosis in these cells by modulating key signaling pathways, thereby preventing cell proliferation and enhancing programmed cell death. This mechanism underscores its potential as a chemopreventive agent.Formula:C19H18O6Purity:Min. 95%Color and Shape:PowderMolecular weight:342.34 g/mol


