CAS 148152-63-0
:Napitane
Description:
Napitane, with the CAS number 148152-63-0, is a chemical compound that belongs to the class of cyclic amines. It is characterized by its unique molecular structure, which includes a bicyclic framework. This compound is known for its potential applications in various fields, including pharmaceuticals and materials science. Napitane exhibits properties such as moderate solubility in organic solvents and stability under standard conditions. Its reactivity can be influenced by the presence of functional groups, making it a subject of interest for synthetic chemistry. Additionally, studies on Napitane may explore its biological activity, although specific data on its pharmacological effects may be limited. As with any chemical substance, safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use. Overall, Napitane represents a noteworthy compound within its category, warranting further investigation for its practical applications and effects.
Formula:C22H25NO2
InChI:InChI=1/C22H25NO2/c1-2-5-16(6-3-1)17-11-12-23(13-17)14-18-7-4-8-20-19(18)9-10-21-22(20)25-15-24-21/h1-3,5-6,9-10,17-18H,4,7-8,11-15H2
SMILES:c1ccc(cc1)C1CCN(C1)CC1CCCc2c1ccc1c2OCO1
Synonyms:- A 75200
- 3-Phenyl-1-(6,7,8,9-Tetrahydronaphtho[1,2-D][1,3]Dioxol-6-Ylmethyl)Pyrrolidine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Napitane
CAS:napitane (A 75200) is a novel catecholamine uptake inhibitor with inhibitory effects on α-adrenergic receptors and potential antidepressant activity for the
Formula:C22H25NO2Purity:99.77% - 99.89%Color and Shape:SolidMolecular weight:335.44Napitane
CAS:Napitane is a peptide that is used as a research tool in the field of cell biology and pharmacology. It can be used to study protein interactions by acting as an inhibitor of the receptor or ligand. Napitane has been shown to inhibit ion channels, which are membrane proteins that regulate ion flow across the cell membrane. It also inhibits the opening of calcium channels, leading to decreased neurotransmitter release in cells. Napitane is a highly potent inhibitor with high purity and a CAS number of 148152-63-0.
Formula:C22H25NO2Purity:Min. 95%Molecular weight:335.40 g/molRef: 3D-YFA15263
Discontinued product



