CAS 14816-16-1
:Phoxim-methyl
Description:
Phoxim-methyl, with the CAS number 14816-16-1, is an organophosphorus compound primarily used as an insecticide and acaricide in agricultural applications. It is characterized by its ability to inhibit acetylcholinesterase, an enzyme critical for the proper functioning of the nervous system in insects, leading to paralysis and death. Phoxim-methyl is typically a colorless to pale yellow liquid with a distinctive odor, and it is soluble in organic solvents but has limited solubility in water. Its chemical structure includes a phosphorus atom bonded to various functional groups, contributing to its biological activity. The compound is known for its effectiveness against a wide range of pests, making it valuable in crop protection. However, like many organophosphates, it poses potential risks to non-target organisms, including humans, necessitating careful handling and application. Regulatory measures often govern its use to mitigate environmental impact and ensure safety. Overall, Phoxim-methyl exemplifies the dual nature of agricultural chemicals, offering benefits in pest control while requiring responsible management to minimize adverse effects.
Formula:C10H11N2O3PS
InChI:InChI=1S/C10H11N2O3PS/c1-13-16(17,14-2)15-12-10(8-11)9-6-4-3-5-7-9/h3-7H,1-2H3
InChI key:InChIKey=QQVNWNVUGXNUJN-UHFFFAOYSA-N
SMILES:C(=NOP(OC)(OC)=S)(C#N)C1=CC=CC=C1
Synonyms:- Benzeneacetonitrile, α-[[(dimethoxyphosphinothioyl)oxy]imino]-
- Phoxim-methyl
- Glyoxylonitrile, phenyl-, oxime, O,O-dimethyl phosphorothioate
- 2,4-Dioxa-5-aza-3-phosphahept-5-ene-7-nitrile, 3-methoxy-6-phenyl-, 3-sulfide
- Phosphorothioic acid, O-[(cyanophenylmethyl)azanyl] O,O-dimethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
