CAS 1481636-41-2
:5-[(1-Oxohexadecyl)oxy]octadecanoic acid
Description:
5-[(1-Oxohexadecyl)oxy]octadecanoic acid, identified by its CAS number 1481636-41-2, is a fatty acid derivative characterized by a long hydrocarbon chain structure. This compound features a carboxylic acid functional group, which is typical of fatty acids, and an ether linkage due to the presence of the hexadecyl moiety. The presence of the oxo group indicates that there is a carbonyl functionality within the hexadecyl chain, contributing to its reactivity and potential applications in various chemical processes. The long hydrophobic hydrocarbon chains suggest that this substance may exhibit surfactant properties, making it useful in formulations for emulsification or stabilization. Additionally, the structural characteristics imply that it may have applications in the fields of biochemistry, materials science, or as a potential bioactive compound. Its solubility and behavior in different solvents would depend on the balance between the hydrophobic and hydrophilic regions of the molecule, influencing its interactions in biological systems or industrial applications.
Formula:C34H66O4
InChI:InChI=1S/C34H66O4/c1-3-5-7-9-11-13-15-16-18-20-22-24-26-31-34(37)38-32(29-27-30-33(35)36)28-25-23-21-19-17-14-12-10-8-6-4-2/h32H,3-31H2,1-2H3,(H,35,36)
InChI key:InChIKey=QBGKCWKQYJQHJX-UHFFFAOYSA-N
SMILES:C(OC(CCCCCCCCCCCCCCC)=O)(CCCCCCCCCCCCC)CCCC(O)=O
Synonyms:- 5-PAHSA
- 5-[(1-Oxohexadecyl)oxy]octadecanoic acid
- Octadecanoic acid, 5-[(1-oxohexadecyl)oxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
5-PAHSA
CAS:5-PAHSA, a FAHFA formed through the formal condensation of the carboxy group of palmitic acid with the hydroxy group of 5-hydroxystearic acid, serves as a human metabolite, possesses anti-inflammatory and hypoglycemic properties, and is categorized as a long-chain fatty acid. This compound, deriving from hexadecanoic acid and octadecanoic acid, is the conjugate acid of a 5-PAHSA(1-).Formula:C34H66O4Color and Shape:SolidMolecular weight:538.898

