CymitQuimica logo

CAS 14817-39-1

:

2-[[2-(2-Propyn-1-yloxy)phenoxy]methyl]oxirane

Description:
2-[[2-(2-Propyn-1-yloxy)phenoxy]methyl]oxirane, identified by its CAS number 14817-39-1, is an organic compound characterized by its epoxide functional group, which is a three-membered cyclic ether. This compound features a complex structure that includes a phenoxy group and a propynyl ether moiety, contributing to its reactivity and potential applications in organic synthesis. The presence of the epoxide ring indicates that it can undergo ring-opening reactions, making it useful in various chemical transformations. Additionally, the propynyl group may impart unique properties, such as increased hydrophobicity or the ability to participate in further reactions, including polymerization or cross-linking. The compound's solubility, stability, and reactivity can vary depending on the surrounding conditions, such as temperature and the presence of catalysts or nucleophiles. Overall, 2-[[2-(2-Propyn-1-yloxy)phenoxy]methyl]oxirane is of interest in fields such as materials science, pharmaceuticals, and polymer chemistry due to its versatile chemical behavior.
Formula:C12H12O3
InChI:InChI=1S/C12H12O3/c1-2-7-13-11-5-3-4-6-12(11)15-9-10-8-14-10/h1,3-6,10H,7-9H2
InChI key:InChIKey=OCDHRUIARWXIBR-UHFFFAOYSA-N
SMILES:O(CC1CO1)C2=C(OCC#C)C=CC=C2
Synonyms:
  • 2-[[2-(2-Propyn-1-yloxy)phenoxy]methyl]oxirane
  • Benzene, 1-(2,3-epoxypropoxy)-2-(2-propynyloxy)-
  • Oxirane, 2-[[2-(2-propyn-1-yloxy)phenoxy]methyl]-
  • Oxirane, [[2-(2-propynyloxy)phenoxy]methyl]-
  • 1-(2-Propargyloxyphenoxy)-2,3-epoxypropane
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.