
CAS 148184-12-7
:Propanedioic acid, 2-methylene-, 1-(2-ethoxy-2-oxoethyl) 3-ethyl ester, homopolymer
Description:
Propanedioic acid, 2-methylene-, 1-(2-ethoxy-2-oxoethyl) 3-ethyl ester, homopolymer, identified by CAS number 148184-12-7, is a synthetic polymer characterized by its structure derived from the polymerization of specific monomer units. This compound typically exhibits properties such as good thermal stability, chemical resistance, and flexibility, making it suitable for various applications in coatings, adhesives, and sealants. The presence of ethoxy and keto groups in its structure can enhance its solubility in organic solvents and may contribute to its reactivity in further chemical modifications. Additionally, the polymer's molecular weight and degree of polymerization can significantly influence its physical properties, including viscosity and mechanical strength. As with many polymers, its performance can be tailored through copolymerization or blending with other materials, allowing for a wide range of applications in industrial and consumer products. Safety and handling considerations should be taken into account, as with all chemical substances, to ensure proper usage and minimize exposure risks.
Formula:(C10H14O6)x
InChI:InChI=1S/C10H14O6/c1-4-14-8(11)6-16-10(13)7(3)9(12)15-5-2/h3-6H2,1-2H3
InChI key:InChIKey=CSRWUEBGICZSEL-UHFFFAOYSA-N
SMILES:C(C(OCC(OCC)=O)=O)(C(OCC)=O)=C
Synonyms:- Methylidene malonate 2.1.2 homopolymer
- Poly(methylidene malonate 2.1.2)
- Propanedioic acid, methylene-, 2-ethoxy-2-oxoethyl ethyl ester, homopolymer
- Propanedioic acid, 2-methylene-, 1-(2-ethoxy-2-oxoethyl) 3-ethyl ester, homopolymer
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Propanedioic acid, 2-methylene-, 1-(2-ethoxy-2-oxoethyl) 3-ethyl ester, homopolymer
CAS:Formula:C10H14O6Molecular weight:230.2146
