CAS 1482-70-8

(5α)-Androstane-3,11,17-trione

Description:

(5α)-Androstane-3,11,17-trione, with the CAS number 1482-70-8, is a steroid compound that belongs to the class of androgens. It is characterized by a steroid backbone, which consists of four fused carbon rings. This compound features three ketone functional groups located at the 3, 11, and 17 positions of the steroid structure, contributing to its reactivity and biological activity. (5α)-Androstane-3,11,17-trione is known for its role in various biochemical pathways, particularly in the synthesis of other steroid hormones. It exhibits potential anabolic properties, making it of interest in both medical and athletic contexts. The compound is typically a white to off-white crystalline solid and is soluble in organic solvents. Its stability and reactivity can be influenced by environmental factors such as pH and temperature. As with many steroid derivatives, it may have implications in pharmacology and endocrinology, particularly in studies related to hormone regulation and metabolic processes.

Formula: C₁₉H₂₆O₃

InChI: InChI=1S/C19H26O3/c1-18-8-7-12(20)9-11(18)3-4-13-14-5-6-16(22)19(14,2)10-15(21)17(13)18/h11,13-14,17H,3-10H2,1-2H3/t11-,13-,14-,17+,18-,19-/m0/s1

InChI key: InChIKey=VRHVOUYZPKSINF-XNTXBEAUSA-N

SMILES: C[C@@]12[C@@]3([C@]([C@]4([C@](C)(CC3=O)C(=O)CC4)[H])(CC[C@]1(CC(=O)CC2)[H])[H])[H]

Synonyms:

• (5Α)-Androstane-3,11,17-Trione
• Androstane-3,11,17-trione, (5α)-

(5α)-Androstane-3,11,17-trione

Controlled Product

CAS: 1482-70-8

Applications A Cortisol metabolite.
References Grillitsch, B. et al.: Environ. Toxicol. Chem. 29, 1613 (2010)

Formula: C₁₉H₂₆O₃

Color and Shape: Neat

Molecular weight: 302.41

Ref: TR-A637650

(5a)-Androstane-3,11,17-trione

Controlled Product

CAS: 1482-70-8

(5a)-Androstane-3,11,17-trione is a synthetic, non-steroidal, androgenic steroid. It is a hydrophobic compound that binds to the androgen receptor. (5a)-Androstane-3,11,17-trione has affinity for the carbonyl group of amino acids on the surface of the receptor. This binding causes conformational changes in the ligand that lead to an interaction with the hydrophobic regions of the receptor. The carbonyl group of amino acid residues also influences this interaction by stabilizing it through hydrogen bonding. Optimization of these interactions led to increased affinity for the androgen receptor in comparison to other compounds such as testosterone or methyltestosterone.

Formula: C₁₉H₂₆O₃

Purity: Min. 95%

Molecular weight: 302.41 g/mol

Ref: 3D-FA17910