CymitQuimica logo

CAS 148204-38-0

:

Thioimidodicarbonic acid ((HO)C(O)NHC(S)(OH)), 1-dodecyl ester 3-(2-pyridinylmethyl) ester

Description:
Thioimidodicarbonic acid, specifically the compound with the name "Thioimidodicarbonic acid ((HO)C(O)NHC(S)(OH)), 1-dodecyl ester 3-(2-pyridinylmethyl) ester" and CAS number 148204-38-0, is a complex organic molecule characterized by its functional groups, including carboxylic acid, amine, and thiol functionalities. This compound features a dodecyl ester group, which contributes to its hydrophobic properties, making it potentially useful in applications involving surfactants or emulsifiers. The presence of a pyridine moiety suggests potential interactions with metal ions or biological systems, enhancing its utility in coordination chemistry or as a ligand. The thioimidodicarbonic acid structure indicates that it may exhibit unique reactivity due to the presence of sulfur, which can participate in various chemical reactions, including nucleophilic attacks. Overall, this compound's unique combination of hydrophilic and hydrophobic characteristics, along with its diverse functional groups, positions it as a versatile candidate for research in fields such as medicinal chemistry, materials science, and environmental chemistry.
Formula:C20H32N2O3S
InChI:InChI=1S/C20H32N2O3S/c1-2-3-4-5-6-7-8-9-10-13-16-24-19(23)22-20(26)25-17-18-14-11-12-15-21-18/h11-12,14-15H,2-10,13,16-17H2,1H3,(H,22,23,26)
InChI key:InChIKey=USAVBSCVXCQFTJ-UHFFFAOYSA-N
SMILES:C(OC(NC(OCCCCCCCCCCCC)=O)=S)C1=CC=CC=N1
Synonyms:
  • Thioimidodicarbonic acid ((HO)C(O)NHC(S)(OH)), 1-dodecyl ester 3-(2-pyridinylmethyl) ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.