CymitQuimica logo

CAS 148214-86-2

:

trans-3-methoxy-4-hydroxy-1-Boc-Pyrrolidine

Description:
Trans-3-methoxy-4-hydroxy-1-Boc-pyrrolidine is a chemical compound characterized by its pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. The "trans" configuration indicates the specific spatial arrangement of substituents around the ring, which can influence its reactivity and interactions. The presence of a methoxy group (-OCH3) and a hydroxy group (-OH) contributes to its polarity and potential for hydrogen bonding, making it soluble in polar solvents. The Boc (tert-butyloxycarbonyl) protecting group is commonly used in organic synthesis to protect amines during reactions, enhancing the compound's utility in various synthetic pathways. This compound is of interest in medicinal chemistry and organic synthesis due to its structural features, which may impart biological activity or serve as intermediates in the synthesis of more complex molecules. Its specific properties, such as melting point, boiling point, and reactivity, would depend on the conditions under which it is studied or utilized.
Formula:C10H19NO4
InChI:InChI=1S/C10H19NO4/c1-10(2,3)15-9(13)11-5-7(12)8(6-11)14-4/h7-8,12H,5-6H2,1-4H3/t7-,8-/m1/s1
InChI key:XAJCELXHUNUFBB-HTQZYQBOSA-N
SMILES:CC(C)(C)OC(=O)N1C[C@H]([C@@H](C1)OC)O
Found 5 products.