CAS 148244-82-0
:Seco-isolariciresinol diglucoside
Description:
Seco-isolariciresinol diglucoside (CAS 148244-82-0) is a lignan compound primarily found in various plants, particularly in flaxseed and certain fruits. It is a glycoside, meaning it consists of a sugar moiety attached to a non-sugar component, which in this case is a seco-lignan structure. This compound is known for its potential health benefits, including antioxidant properties and possible roles in cancer prevention and cardiovascular health. Its structure features two glucose units linked to a seco-isolariciresinol backbone, which contributes to its biological activity. Seco-isolariciresinol diglucoside is often studied for its pharmacological effects, including anti-inflammatory and neuroprotective properties. Additionally, it is of interest in the field of nutraceuticals due to its presence in dietary sources and its potential impact on human health. As with many natural compounds, its bioavailability and metabolism in the human body are subjects of ongoing research, aiming to elucidate its mechanisms of action and therapeutic potential.
Formula:C26H38O12
InChI:InChI=1/C20H26O6.C6H12O6/c1-25-19-9-13(3-5-17(19)23)7-15(11-21)16(12-22)8-14-4-6-18(24)20(10-14)26-2;7-1-2-3(8)4(9)5(10)6(11)12-2/h3-6,9-10,15-16,21-24H,7-8,11-12H2,1-2H3;2-11H,1H2/t15-,16-;2-,3-,4+,5-,6-/m01/s1
Synonyms:- Seco-isolariciresinol diglucoside(SDG)(P)
- Secoisolariciresinol Diglucosi
- 2,3-Bis(3-methoxy-4-hydroxybenzyl)butane-1,4-diol 1,4-diglucoside
- Flaxseed Extract
- SDG,Seco-isolariciresinol diglucoside
- (2R,3R)-2,3-bis(4-hydroxy-3-methoxybenzyl)butane-1,4-diol - beta-D-glucopyranose (1:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
β-D-Glucopyranose, diglycoside with (2R,3R)-2,3-bis[(4-hydroxy-3-methoxyphenyl)methyl]-1,4-butanediol
CAS:Formula:C32H46O16Purity:97%Color and Shape:SolidMolecular weight:686.6980Secoisolariciresinol diglucoside
CAS:Secoisolariciresinol diglucosidePurity:98%Color and Shape:Yellow-Brown PowderMolecular weight:686.70g/molSecoisolariciresinol diglucoside
CAS:Formula:C32H46O16Purity:≥ 98.0%Color and Shape:White to off-white crystalline powderMolecular weight:686.70Secoisolariciresinol diglucoside
CAS:Secoisolariciresinol diglucoside is a plant lignan, which is primarily sourced from flaxseed. As a type of phytoestrogen, SDG is known for its antioxidant properties and ability to influence estrogen metabolism. The mode of action involves the conversion of SDG into mammalian lignans such as enterolactone and enterodiol by intestinal microflora, which then exhibit biological activity. These metabolites can bind to estrogen receptors, thereby exerting weak estrogenic or antiestrogenic effects depending on endogenous estrogen levels.Formula:C32H46O16Purity:Min. 95%Color and Shape:PowderMolecular weight:686.71 g/mol



