CAS 148254-32-4

5-Bromo-2-chloro-4-fluoro-phenol

Description:

5-Bromo-2-chloro-4-fluoro-phenol is an organic compound characterized by the presence of multiple halogen substituents on a phenolic ring. This compound features a bromine atom at the 5-position, a chlorine atom at the 2-position, and a fluorine atom at the 4-position of the benzene ring, along with a hydroxyl (-OH) group, which imparts phenolic properties. The presence of these halogens can significantly influence the compound's reactivity, solubility, and biological activity. Typically, such halogenated phenols exhibit antimicrobial properties and can be utilized in various applications, including pharmaceuticals and agrochemicals. The molecular structure contributes to its potential as a building block in organic synthesis. Additionally, the compound's physical properties, such as melting point and boiling point, are influenced by the electronegativity and steric effects of the halogen substituents. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₆H₃BrClFO

InChI: InChI=1/C6H3BrClFO/c7-3-1-6(10)4(8)2-5(3)9/h1-2,10H

SMILES: c1c(c(cc(c1O)Cl)F)Br

Synonyms:

• 5-Bromo-2-Chloro-4-fluorophenol
• Phenol, 5-Bromo-2-Chloro-4-Fluoro-
• 5-broMo-2-chloro-4-fluorphenol

Phenol, 5-bromo-2-chloro-4-fluoro-

CAS: 148254-32-4

Formula: C₆H₃BrClFO

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.4428

Ref: IN-DA001FKC

5-Bromo-2-chloro-4-fluorophenol

CAS: 148254-32-4

5-Bromo-2-chloro-4-fluorophenol

Formula: C₆H₃BrClFO

Purity: 95%

Color and Shape: white fused solid

Molecular weight: 225.44g/mol

Ref: 54-PC500254

5-Bromo-2-chloro-4-fluorophenol

CAS: 148254-32-4

Formula: C₆H₃BrClFO

Purity: 95%

Color and Shape: Solid

Molecular weight: 225.44

Ref: 10-F077795