CAS 1483-27-8
:2,5-Dimethoxythiophenol
Description:
2,5-Dimethoxythiophenol, with the CAS number 1483-27-8, is an organic compound characterized by the presence of a thiophenol moiety substituted with two methoxy groups at the 2 and 5 positions of the thiophene ring. This compound typically appears as a solid or liquid, depending on its purity and specific conditions. It is known for its aromatic properties and can exhibit both nucleophilic and electrophilic reactivity due to the presence of the thiol (-SH) group. The methoxy groups enhance its solubility in organic solvents and can influence its electronic properties, making it useful in various chemical applications, including organic synthesis and as a potential intermediate in the production of dyes or pharmaceuticals. Additionally, the compound may exhibit antioxidant properties, which can be of interest in biochemical research. Safety data should be consulted for handling, as thiophenols can be toxic and have strong odors. Overall, 2,5-Dimethoxythiophenol is a versatile compound with significant implications in organic chemistry.
Formula:C8H10O2S
InChI:InChI=1/C8H10O2S/c1-9-6-3-4-7(10-2)8(11)5-6/h3-5,11H,1-2H3
SMILES:COc1ccc(c(c1)S)OC
Synonyms:- 2,5-Dimethoxybenzenethiol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Benzenethiol, 2,5-dimethoxy-
CAS:Formula:C8H10O2SPurity:98%Color and Shape:LiquidMolecular weight:170.22882,5-Dimethoxythiophenol
CAS:2,5-DimethoxythiophenolPurity:≥95%Color and Shape:Colourless LiquidMolecular weight:170.23g/mol2,5-Dimethoxythiophenol
CAS:Controlled ProductApplications 2,5-Dimethoxythiophenol is a thiophenol derivative used in the preparation of dihydrofolate reductase inhibitors and potential antitumor agents.
References Gangjee, A. et al.: J. Med. Chem., 52, 4892 (2009); Gangjee, A. et al.: Biiorg. Med. Chem., 18, 953 (2010);Formula:C8H10O2SColor and Shape:NeatMolecular weight:170.23



