CAS 1484-19-1
:3-Ethylindole
Description:
3-Ethylindole is an organic compound belonging to the indole family, characterized by a bicyclic structure that consists of a fused benzene and pyrrole ring. It is a colorless to pale yellow liquid with a distinct aromatic odor. The presence of the ethyl group at the 3-position of the indole ring influences its chemical properties, including its reactivity and solubility. 3-Ethylindole is known for its role in various chemical reactions, particularly in the synthesis of more complex organic molecules. It exhibits moderate solubility in organic solvents and is relatively stable under standard conditions. This compound is of interest in fields such as organic synthesis, medicinal chemistry, and fragrance formulation due to its unique structural features and potential biological activities. Additionally, 3-Ethylindole can be found in certain natural products and has been studied for its effects in biological systems, including its potential role in signaling pathways. Safety precautions should be observed when handling this compound, as it may pose health risks if ingested or inhaled.
Formula:C10H11N
InChI:InChI=1/C10H11N/c1-2-8-7-11-10-6-4-3-5-9(8)10/h3-7,11H,2H2,1H3
SMILES:CCc1c[nH]c2ccccc12
Synonyms:- 1H-indole, 3-ethyl-
- 3-Ethyl-1H-indole
- 3-Ethyl-Indole
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3-Ethyl-1H-indole
CAS:3-Ethyl-1H-indole is a chiral compound with a high degree of stereoselectivity. It is synthesized by the reaction of ethyl formate and diethyl malonate in the presence of sulfuric acid, magnesium and liquid chromatography. The product can be purified by vacuum distillation or recrystallization. 3-Ethyl-1H-indole is used as a starting material for the synthesis of other aromatic compounds. 3-Ethyl-1H-indole has been shown to be useful in the production of pharmaceuticals and agrochemicals.
Formula:C10H11NPurity:Min. 95%Molecular weight:145.2 g/mol


